N,N'-Dioctyl-3,4,9,10-perylenedicarboximide manufacturers
|
| | N,N'-Dioctyl-3,4,9,10-perylenedicarboximide Basic information |
| Product Name: | N,N'-Dioctyl-3,4,9,10-perylenedicarboximide | | Synonyms: | N,N'-dioctyl-perylene-3,4,9,10-tetracarboxylic acid diimide;Perylene-3,4,9,10-tetracarboxylic acid N,N'-dioctylimide;N,N'-Dioctyl-3,4,9,10-perylenedicarboxiMide 98%;2,9-dioctylanthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone;N,N'-Di-n-octyl-3,4,9,10-perylenetetracarboxylic Diimide;PDI8;N,N'-Di-n-octyl-3,4,9,10-perylenetetracarboxylicDiimide>Anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetrone, 2,9-dioctyl- | | CAS: | 78151-58-3 | | MF: | C40H42N2O4 | | MW: | 614.77 | | EINECS: | | | Product Categories: | OTFT/OFET/OPV Materials | | Mol File: | Mol File |  |
| | N,N'-Dioctyl-3,4,9,10-perylenedicarboximide Chemical Properties |
| Melting point | >300 °C | | Boiling point | 775.4±33.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | form | powder to crystal | | pka | -2.25±0.20(Predicted) | | color | Orange to Amber to Dark red | | semiconductor properties | N-type (mobility=1.7cm2/V·s) | | λmax | 526 nm | | InChIKey | YFGMQDNQVFJKTR-UHFFFAOYSA-N | | SMILES | CCCCCCCCN1C(=O)c2ccc3c4ccc5C(=O)N(CCCCCCCC)C(=O)c6ccc(c7ccc(C1=O)c2c37)c4c56 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | HS Code | 29251900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N,N'-Dioctyl-3,4,9,10-perylenedicarboximide Usage And Synthesis |
| Uses | PTCDI-C8 can be used as an organic semiconductor to fabricate a wide range of opto-electronic based devices such as light emitting diodes, photovoltaic cells, and field effect transistors. |
| | N,N'-Dioctyl-3,4,9,10-perylenedicarboximide Preparation Products And Raw materials |
|