| Company Name: |
INTATRADE GmbH |
| Tel: |
+49 3493/605464 |
| Email: |
sales@intatrade.de |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | N,N'-Di-1-naphthyl-N,N'-diphenylbenzidine (NPB) Basic information |
| Product Name: | N,N'-Di-1-naphthyl-N,N'-diphenylbenzidine (NPB) | | Synonyms: | N,N'-Bis- (1-naphthalenyl)-N,N'-bis-phenyl-(1,1'-biphenyl)-4,4'-diamine;N,N'-BIS(NAPHTHALEN-1-YL)-N,N'-BIS(PHENYL)BENZIDINE;n,n'-di-[(1-naphthyl)-n,n'-diphenyl]-1,1'-biphenyl)-4,4'-diamine;N,N'-Bis(1-naphthyl)-N,N'-bis(phenyl)benzidine, 98%;ALPHA-NPB;ALPHA NAPHTHYLPHENYL BENZIDINE;4,4'-BIS[N-(1-NAPHTHYL)-N-PHENYLAMINO]BIPHENYL;N,N'-di-(Naphthalen-1-yl)-N,N'-diphenyl benzidine | | CAS: | 123847-85-8 | | MF: | C44H32N2 | | MW: | 588.74 | | EINECS: | 1312995-182-4 | | Product Categories: | oled materials;electronic;pharmacetical;Light yellow powder;fine chemicals, specialty chemicals, intermediates, electronic chemical, organic synthesis, pharmaceutical;fine chemicals, specialty chemicals, intermediates, electronic chemical, organic synthesis, functional materials;OLED | | Mol File: | 123847-85-8.mol |  |
| | N,N'-Di-1-naphthyl-N,N'-diphenylbenzidine (NPB) Chemical Properties |
| Melting point | 279-283°C | | Boiling point | 772.5±53.0 °C(Predicted) | | density | 1.213±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Heated), DMSO (Slightly, Heated, Sonicated), Ethyl Acetate (Slightly) | | pka | -0.08±0.50(Predicted) | | form | Powder | | color | Pale yellow | | λmax | 339nm(THF)(lit.) | | InChIKey | IBHBKWKFFTZAHE-UHFFFAOYSA-N | | SMILES | C1(C2=CC=C(N(C3=C4C(C=CC=C4)=CC=C3)C3=CC=CC=C3)C=C2)=CC=C(N(C2=C3C(C=CC=C3)=CC=C2)C2=CC=CC=C2)C=C1 | | CAS DataBase Reference | 123847-85-8(CAS DataBase Reference) | | Absorption | λmax = 339 nm |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29215900 | | Storage Class | 11 - Combustible Solids |
| | N,N'-Di-1-naphthyl-N,N'-diphenylbenzidine (NPB) Usage And Synthesis |
| Description | N,N′-Di(1-naphthyl)-N,N′-diphenyl-(1,1′-biphenyl)-4,4′-diamine, also known as NPB or NPD, has been used intensively in OLEDs and other organic electronic devices such as polymer photovoltaics (OPV) and perovskite solar cells for its outstanding hole transport capability. NPB is considered as one of the best materials within its competition, and has become the most common-used material in OLEDs' application. This is due to its increased Tg up to 95 °C, which enhances device morphology and is beneficial for device longevity. | | Chemical Properties | Light yellow to yellow powder | | Uses |
N,N'-Bis- (1-naphthalenyl)-N,N'-bis-phenyl-(1,1'-biphenyl)-4,4'-diamine is used as a hole transporting material for OLED devices.
| | General Description | TGA/DSC Lot specific traces available upon request |
| | N,N'-Di-1-naphthyl-N,N'-diphenylbenzidine (NPB) Preparation Products And Raw materials |
|