| Company Name: |
BOC Sciences |
| Tel: |
+1-631-485-4226 |
| Email: |
inquiry@bocsci.com |
|
| | D-Arabinose 5-phosphate disodium salt Basic information |
| | D-Arabinose 5-phosphate disodium salt Chemical Properties |
| storage temp. | −20°C | | solubility | water: 50 mg/mL, clear | | form | powder | | color | white to off-white | | InChI | 1S/C5H11O8P.Na.H/c6-1-3(7)5(9)4(8)2-13-14(10,11)12;;/h1,3-5,7-9H,2H2,(H2,10,11,12);; | | InChIKey | JOSPLEVEDMZOKB-UHFFFAOYSA-N | | SMILES | [Na].OC(COP(O)(O)=O)C(O)C(O)C=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | - | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | D-Arabinose 5-phosphate disodium salt Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | D-Arabinose 5-phosphate (D-Ara-5P) is used as a substrate to identify, differentiate and characterize enzymes such as D-arabinose 5-phosphate isomerase (KdsD) and 3-deoxy-D-manno-octulosonate 8-phosphate synthase(s) which are involved in lipopolysaccharide (LPS) biosynthesis. |
| | D-Arabinose 5-phosphate disodium salt Preparation Products And Raw materials |
|