| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:Methiocarb Sulfoxide
CAS:2635-10-1
Package:2.5g,250Mg
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:Methiocarb-sulfoxide
CAS:2635-10-1
Remarks:Reach out to us for more information about custom solutions.
|
|
| | METHIOCARB SULFOXIDE Basic information |
| | METHIOCARB SULFOXIDE Chemical Properties |
| Boiling point | 399.0±42.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | 0-6°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | pka | 12.03±0.46(Predicted) | | Stability: | Hygroscopic | | Major Application | agriculture
environmental | | InChI | 1S/C11H15NO3S/c1-7-5-9(15-11(13)12-3)6-8(2)10(7)16(4)14/h5-6H,1-4H3,(H,12,13) | | InChIKey | FNCMBMZOZQAWJA-UHFFFAOYSA-N | | SMILES | CNC(=O)Oc1cc(C)c(c(C)c1)S(C)=O | | EPA Substance Registry System | Methiocarb sulfoxide (2635-10-1) |
| Hazard Codes | T,N | | Risk Statements | 25-50/53 | | Safety Statements | 45-60-61 | | RIDADR | 2757 | | WGK Germany | 3 | | RTECS | FC5075000 | | HazardClass | 6.1(b) | | PackingGroup | III | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Oral
Aquatic Acute 1 |
| | METHIOCARB SULFOXIDE Usage And Synthesis |
| Uses | Methiocarb Sulfoxide acts as a pesticide which is used in the protection of crops from insects and fungus. | | Definition | ChEBI: A carbamate ester obtained by the formal condensation of the phenolic group of 3,5-dimethyl-4-(methylsulfinyl)phenol with the carboxy group of methylcarbamic acid. It is a metabolite of the pesticide methiocarb. |
| | METHIOCARB SULFOXIDE Preparation Products And Raw materials |
|