| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Acetylacetonato(1,5-cyclooctadiene)rhodium(I) Basic information | | Reactions |
| Product Name: | Acetylacetonato(1,5-cyclooctadiene)rhodium(I) | | Synonyms: | (1,5-Cyclooctadiene)rhodium(I) 2,4-pentanedionate;(1,5-cyclooctadiene)(2,4-pentanedionato)rhodium(I);Acetylacetonato(1,5-cyclooctadiene)rhodium(I),97%;Acetylacetonato(1,5-;(Acetylacetonato)(1,5-cyclooctadiene)rhodium(Ⅰ);NSC 240030;RHODIUM (1,5-CYCLOOCTADIENE)-2,4-PENTANEDIONATE;((1,2,5,6-eta)-1,5-cyclooctadiene)(2,4-pentanedionato-o,o’)-rhodiu | | CAS: | 12245-39-5 | | MF: | C13H19O2Rh | | MW: | 310.19 | | EINECS: | | | Product Categories: | organometallic complex;Rh | | Mol File: | 12245-39-5.mol |  |
| | Acetylacetonato(1,5-cyclooctadiene)rhodium(I) Chemical Properties |
| Melting point | 138-140 °C(lit.) | | storage temp. | Inert atmosphere,2-8°C | | form | Crystals | | color | Yellow to orange | | Sensitive | Air Sensitive | | Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents | | Exposure limits | ACGIH: TWA 1 mg/m3
NIOSH: IDLH 100 mg/m3; TWA 0.1 mg/m3 | | InChI | 1S/C8H12.C5H8O2.Rh/c1-2-4-6-8-7-5-3-1;1-4(6)3-5(2)7;/h1-2,7-8H,3-6H2;3,6H,1-2H3;/q;;+1/p-1/b2-1-,8-7-;4-3-; | | InChIKey | WDIAJTWVVLHUJU-SUESZSCISA-N | | SMILES | CC(=O)\C=C(\C)O[Rh].C1CC=CCCC=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | RTECS | VI9292000 | | TSCA | No | | HS Code | 28439000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2 |
| | Acetylacetonato(1,5-cyclooctadiene)rhodium(I) Usage And Synthesis |
| Reactions |
- Precursor for asymmetric hydrogenation reactions.
- Rh-catalyzed carbozincation of ynamides.
| | Chemical Properties | Orange crystal | | Uses | Umicore Precatalysts for Asymmetric and Cross-Coupling Catalysis | | General Description | Atomic number of base material: 45 Rhodium | | reaction suitability | reagent type: catalyst | | Safety Profile | Poison by
intraperitoneal route. When heated to
decomposition it emits toxic fumes of Rh |
| | Acetylacetonato(1,5-cyclooctadiene)rhodium(I) Preparation Products And Raw materials |
|