|
|
| | Acetylacetonatobis(ethylene)rhodium(I) Basic information |
| Product Name: | Acetylacetonatobis(ethylene)rhodium(I) | | Synonyms: | (Acetylacetonato)bis(ethylene)rhodium;2,4-Pentanedionatobis(ethylene)rhodium;Acetylacetonatobis(ethylene)rhodium(1);Bis(ethylene)(2,4-pentanedionato)rhodium;Bis(ethylene)rhodium(I) acetylacetonate;Bisethylenerhodium acetylacetonate;Diethylene(acetylacetonato)rhodium;Rhodium, bis(ethylene)(2,4-pentanedionato)- | | CAS: | 12082-47-2 | | MF: | C9H15O2Rh | | MW: | 258.12 | | EINECS: | 235-147-1 | | Product Categories: | Rh;organometallic complexes | | Mol File: | 12082-47-2.mol |  |
| | Acetylacetonatobis(ethylene)rhodium(I) Chemical Properties |
| Melting point | 141-142°C | | storage temp. | 2-8°C | | solubility | Soluble in dichloromethane, chloroform | | form | Crystals or Crystalline Powder | | color | Orange | | Water Solubility | insoluble | | Sensitive | Air Sensitive | | Exposure limits | ACGIH: TWA 1 mg/m3 NIOSH: IDLH 100 mg/m3; TWA 0.1 mg/m3 | | InChI | 1S/C5H8O2.2C2H4.Rh/c1-4(6)3-5(2)7;2*1-2;/h3,6H,1-2H3;2*1-2H2;/q;;;+1/p-1/b4-3-;;; | | InChIKey | FLRBEQQDEGBCJS-FGSKAQBVSA-M | | SMILES | C=C.C=C.CC(=O)\C=C(\C)O[Rh] | | NIST Chemistry Reference | Rhodium, bis(«eta»2-ethene)(2,4-pentanedionato-o,o')-(12082-47-2) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | No | | HS Code | 28439090 | | Storage Class | 11 - Combustible Solids |
| | Acetylacetonatobis(ethylene)rhodium(I) Usage And Synthesis |
| Chemical Properties | yellow solid | | Uses | It acts as a hydrogenation precursor. It is also used as intermediates which acts as catalyst such as in olefin hydroformylation. | | reaction suitability | core: rhodium reagent type: catalyst |
| | Acetylacetonatobis(ethylene)rhodium(I) Preparation Products And Raw materials |
|