Auxinole manufacturers
- Auxinole
-
- $34.00
-
2026-07-27
- CAS:86445-22-9
- Purity: 98.93%
- Supply Ability: 10g
- Auxinole
-
- $34.00
-
2026-06-02
- CAS:86445-22-9
- Purity: 98.93%
- Supply Ability: 10g
|
| | Auxinole Basic information |
| Product Name: | Auxinole | | Synonyms: | Auxinole;1H-Indole-3-acetic acid, α-[2-(2,4-dimethylphenyl)-2-oxoethyl]-;4-(2,4-Dimethylphenyl)-2-(1H-indol-3-yl)-4-oxobutanoic acid;Inhibitor,inhibit,Auxinole;Auxinole, 10 mM in DMSO | | CAS: | 86445-22-9 | | MF: | C20H19NO3 | | MW: | 321.38 | | EINECS: | | | Product Categories: | | | Mol File: | 86445-22-9.mol |  |
| | Auxinole Chemical Properties |
| Melting point | <170°C (dec.) | | Boiling point | 586.9±50.0 °C(Predicted) | | density | 1.260±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) | | form | Solid | | pka | 4.77±0.37(Predicted) | | color | Off-White to Light Brown | | InChI | InChI=1S/C20H19NO3/c1-12-7-8-14(13(2)9-12)19(22)10-16(20(23)24)17-11-21-18-6-4-3-5-15(17)18/h3-9,11,16,21H,10H2,1-2H3,(H,23,24) | | InChIKey | HGUYAIJBXSQXGV-UHFFFAOYSA-N | | SMILES | C(C1=CNC2C=CC=CC1=2)(C(=O)O)CC(C1C=CC(C)=CC=1C)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Auxinole Usage And Synthesis |
| Uses | Auxinole is a phytohormone which acts as an auxin antagonist. | | Biological Activity | Auxinole is a potent auxin antagonist th at binds to SCF(TIR1) and blocks TIR1-IAA-Aux/IAA complex formation thereby inhibiting auxin-responsive gene expression. |
| | Auxinole Preparation Products And Raw materials |
|