|
|
| | Sphynolactone-7 Basic information |
| Product Name: | Sphynolactone-7 | | Synonyms: | Sphynolactone-7;1-Piperazinecarboxylic acid, 4-[(4-butoxyphenyl)sulfonyl]-, 2,5-dihydro-4-methyl-5-oxo-2-furanyl ester;4-Methyl-5-oxo-2,5-dihydrofuran-2-yl 4-[(4-Butoxyphenyl)sulfonyl]piperazine-1-carboxylate;SPL 7 | | CAS: | 2305752-57-0 | | MF: | C20H26N2O7S | | MW: | 438.49 | | EINECS: | | | Product Categories: | | | Mol File: | 2305752-57-0.mol |  |
| | Sphynolactone-7 Chemical Properties |
| Boiling point | 632.5±65.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: warmed, soluble | | form | A solid | | pka | -2.48±0.70(Predicted) | | color | white to beige | | InChIKey | GGAPQPVAXJSNFU-UHFFFAOYSA-N | | SMILES | CCCCOC1=CC=C(S(N2CCN(C(OC3C=C(C)C(O3)=O)=O)CC2)(=O)=O)C=C1 |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | Sphynolactone-7 Usage And Synthesis |
| Uses | Sphynolactone-7 (SPL7) is an active site-targeting and selective strigolactone receptor (ShHTL7) agonist. Sphynolactone-7 is effective for reducing Striga parasitism without impinging on host strigolactone-related processes[1]. | | Biological Activity | Sphynolactone-7 (SPL-7) is an active site-targeting, highly potent and selective strigolactone receptor ShHTL7 agonist (YLG competitive binding IC50 = 310 nM/ShHTL7, 1.2 μM/ShHTL8, >7.0 μM/ShHTL2-6, ShHTL9-11, AtD14) th at acts as a seeds germination stimulant with femtomolar- and picomolar-level potency, respectively, toward the parasitic plants Striga hermonthica ecotypes and Orobanche minor, while exhibiting no Arabidopsis-stimulatory efficacy. | | References | [1] Uraguchi D, et al. A femtomolar-range suicide germination stimulant for the parasitic plant Striga hermonthica. Science. 2018 Dec 14;362(6420):1301-1305. DOI:10.1126/science.aau5445 |
| | Sphynolactone-7 Preparation Products And Raw materials |
|