- 7-Methyl-1-tetralone
-
- $17.00
-
2026-10-13
- CAS:22009-37-6
- Min. Order: 5g
- Purity: 0.99
- Supply Ability: 25kg
- 7-Methyl-1-tetralone
-
- $50.00
-
2025-05-23
- CAS:22009-37-6
- Min. Order: 1kg
- Purity: 99
- Supply Ability: 5000
|
| Product Name: | 7-Methyl-1-tetralone | | Synonyms: | 7-METHYL-1-TETRALONE;4-dihydro-7-Methyl-;1(2H)-Naphthalenone,3,4-dihydro-7-methyl-;3,4-dihydro-7-methyl-1(2h)-naphthalenon;3,4-dihydro-7-methyl-1(2H)-Naphthalenone;3,4-dihydro-7-methylnaphthalen-1(2H)-one;7-Methyl-3,4-dihydro-2H-naphthalen-1-one;7-Methyl-3,4-dihydronaphthalen-1(2H) | | CAS: | 22009-37-6 | | MF: | C11H12O | | MW: | 160.21 | | EINECS: | 244-717-9 | | Product Categories: | | | Mol File: | 22009-37-6.mol |  |
| | 7-Methyl-1-tetralone Chemical Properties |
| Melting point | 35-36 °C | | Boiling point | 143-145 °C(Press: 15 Torr) | | density | 1.074±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Dichloromethane; Ethyl Acetate | | form | Solid | | color | Yellow-orange | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C11H12O/c1-8-5-6-9-3-2-4-11(12)10(9)7-8/h5-7H,2-4H2,1H3 | | InChIKey | GGMYZZBVIWUXEC-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC(C)=C2)CCC1 | | LogP | 1.684 (est) | | EPA Substance Registry System | 1(2H)-Naphthalenone, 3,4-dihydro-7-methyl- (22009-37-6) |
| TSCA | TSCA listed | | HS Code | 2914390090 |
| | 7-Methyl-1-tetralone Usage And Synthesis |
| Application | 2-Fluoro-5-((4-oxo-3,4-dihydrophthalazin-1-yl)methyl)benzonitrile is an intermediate used in the synthesis of phthalazinone scaffolds that are potent inhibitors of poly(ADP-ribose) polymerase. | | Description | 7-Methyl-1-tetralone belongs to ketone derivatives and can be used as intermediates in organic synthesis. | | Uses | 7-Methyltetralone is an intermediate in the synthesis of (±)-cis-Calamenene (~7:1 ratio of cis/trans) (C124900), a sesquiterpene and a volatile metabolite from Salvia fruticosa plants. This compound may be a potentialantimicrobial, antifungal, and anti-inflammatory agent. |
| | 7-Methyl-1-tetralone Preparation Products And Raw materials |
|