- ISO-OCTYL METHACRYLATE
-
- $10.00 / 1KG
-
2026-03-20
- CAS:28675-80-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- Iso-Octyl Methacrylate
-
- $0.00 / 170kg
-
2026-01-24
- CAS:28675-80-1
- Min. Order: 170kg
- Purity: 99%
- Supply Ability: 20 MT
- Isooctyl methacrylate
-
- $120.00 / 1kg
-
2025-04-15
- CAS:28675-80-1
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 20ton
|
| | 6-Methylheptyl methacrylate Basic information |
| Product Name: | 6-Methylheptyl methacrylate | | Synonyms: | 2-Methyl-2-Propenoic Acid Isooctyl Ester;ISO-OCTYL METHACRYLATE;2-methyl-2-propenoicaciisooctylester;2-Methylpropenoic acid isooctyl ester;2-Propenoic acid, 2-methyl-, isooctyl ester;Einecs 249-144-8;6-methylheptyl 2-methylprop-2-enoate;6-Methylheptyl methacrylate | | CAS: | 28675-80-1 | | MF: | C12H22O2 | | MW: | 198.3 | | EINECS: | 249-144-8 | | Product Categories: | monomer;fine chemical | | Mol File: | 28675-80-1.mol |  |
| | 6-Methylheptyl methacrylate Chemical Properties |
| Boiling point | 247° | | density | 0.879 | | Fp | 91.4° | | storage temp. | 2-8°C, stored under nitrogen | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C12H22O2/c1-10(2)8-6-5-7-9-14-12(13)11(3)4/h10H,3,5-9H2,1-2,4H3 | | InChIKey | NQSLZEHVGKWKAY-UHFFFAOYSA-N | | SMILES | O(CCCCCC(C)C)C(=O)C(=C)C | | EPA Substance Registry System | 2-Propenoic acid, 2-methyl-, isooctyl ester (28675-80-1) |
| | 6-Methylheptyl methacrylate Usage And Synthesis |
| | 6-Methylheptyl methacrylate Preparation Products And Raw materials |
|