|
|
| | POTASSIUM METHACRYLATE Basic information |
| Product Name: | POTASSIUM METHACRYLATE | | Synonyms: | 2-methyl-2-propenoicacipotassiumsalt;POTASSIUM METHACRYLATE;METHACRYLIC ACID, POTASSIUM SALT;2-Propenoic acid, 2-methyl-, potassium salt (1:1);potassium 2-methyl-2-propenoate;Potasium methacrylate;2-Propenoic acid,2-methyl-, potassium salt;POTASSIUM METHACRYLATE ISO 9001：2015 REACH | | CAS: | 6900-35-2 | | MF: | C4H5KO2 | | MW: | 124.18 | | EINECS: | 230-007-6 | | Product Categories: | | | Mol File: | 6900-35-2.mol |  |
| | POTASSIUM METHACRYLATE Chemical Properties |
| Melting point | >200°C (dec.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Hydrolytic Sensitivity | 0: forms stable aqueous solutions | | InChI | InChI=1S/C4H6O2.K/c1-3(2)4(5)6;/h1H2,2H3,(H,5,6);/q;+1/p-1 | | InChIKey | LLLCSBYSPJHDJX-UHFFFAOYSA-M | | SMILES | C(=C)(C)C([O-])=O.[K+] | | EPA Substance Registry System | 2-Propenoic acid, 2-methyl-, potassium salt (6900-35-2) |
| | POTASSIUM METHACRYLATE Usage And Synthesis |
| | POTASSIUM METHACRYLATE Preparation Products And Raw materials |
|