| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | para-Xylylenebis-(triphenylphosphonium Basic information |
| Product Name: | para-Xylylenebis-(triphenylphosphonium | | Synonyms: | p-xylenebis(triphenylphosphonium) dibromide;1,4-Bis[(triphenylphosphonio)methyl]benzene dibromide;para-xylylenebis-(triphenylphosphonium bromide),;[1,4-phenylenebis(methylene)]bis[triphenylphosphonium] dibromide;(1,4-Phenylenebis(Methylene))bis(triphenylphosphoniuM) broMide;Phosphonium,1,1'-[1,4-phenylenebis(methylene)]bis[1,1,1-triphenyl-, bromide (1:2);(p-Xylylene)bis(triphenylphosphonium)·dibromide;1,4-Xylylenebis(triphenylphosphonium)·2bromide | | CAS: | 40817-03-6 | | MF: | C44H38Br2P2 | | MW: | 788.528042 | | EINECS: | 255-092-7 | | Product Categories: | | | Mol File: | 40817-03-6.mol |  |
| | para-Xylylenebis-(triphenylphosphonium Chemical Properties |
| Melting point | >300 °C(lit.) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | Water Solubility | Slightly soluble in water. | | Sensitive | Hygroscopic | | BRN | 3584592 | | InChIKey | ZZQVVCXWFPGKJD-UHFFFAOYSA-L | | SMILES | C1(C[P+](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)=CC=C(C[P+](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C1.[Br-].[Br-] |
| | para-Xylylenebis-(triphenylphosphonium Usage And Synthesis |
| Uses | suzuki reaction | | Uses | p-Xylylenebis(triphenylphosphonium bromide) is used as pharmaceutical intermediate. |
| | para-Xylylenebis-(triphenylphosphonium Preparation Products And Raw materials |
|