| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
(+)-1-(9-Fluorenyl)ethyl chloroformate manufacturers
|
| | (+)-1-(9-Fluorenyl)ethyl chloroformate Basic information |
| Product Name: | (+)-1-(9-Fluorenyl)ethyl chloroformate | | Synonyms: | (+)-1-(9-Fluorenyl)ethyl chloroformate, solution in acetone;(+)-FLEC SOLUTION,50 MG IN 10 ML ACETONE;(+)-1-(9-FLUORENYL)ETHYL CHLOROFORMATE, 18MMOL SOLUTION IN ACETONE;(-)-1-(9-FLUORENYL)ETHYL CHLOROFORMATE, 0.5W/V % SOLUTION IN ACETONE;Carbonochloridic acid,(1S)-1-(9H-fluoren-9-yl)ethyl ester;(S)-Fluorenylethylchloroformate;(+)-1-(9-Fluorenyl)ethyl Chloroformate (18 mM in Acetone);(+)-1-(9-Fluorenyl)ethyl chloroformate solution | | CAS: | 107474-79-3 | | MF: | C16H13ClO2 | | MW: | 272.73 | | EINECS: | | | Product Categories: | | | Mol File: | 107474-79-3.mol |  |
| | (+)-1-(9-Fluorenyl)ethyl chloroformate Chemical Properties |
| Melting point | 94°C | | Boiling point | 56°C/760mmHg | | density | 0.792 g/mL at 20 °C | | vapor density | 2 (vs air) | | vapor pressure | 180 mm Hg ( 20 °C) | | refractive index | n20/D 1.3602 | | Fp | 1 °F | | storage temp. | 2-8°C | | form | liquid | | InChI | 1S/C16H13ClO2/c1-10(19-16(17)18)15-13-8-4-2-6-11(13)12-7-3-5-9-14(12)15/h2-10,15H,1H3 | | InChIKey | SFRVOKMRHPQYGE-UHFFFAOYSA-N | | SMILES | ClC(=O)OC(C1c2c(cccc2)c3c1cccc3)C |
| Hazard Codes | F,Xi | | Risk Statements | 11-36-66-67 | | Safety Statements | 16-26 | | RIDADR | UN 1090 3/PG 2 | | WGK Germany | 3 | | F | 10-21 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 38220090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1
Flam. Liq. 2
STOT SE 3 |
| | (+)-1-(9-Fluorenyl)ethyl chloroformate Usage And Synthesis |
| Chemical Properties | clear colourless liquid | | Uses | (+)-1-(9-Fluorenyl)ethyl Chloroformate is an analytical reagent for direct and indirect chiral separation of amino acids by capillary electrophoresis. | | General Description | (+)-1-(9-Fluorenyl)ethyl chloroformate is a highly fluorescent compound1 commonly used as a chiral derivatizing agent for the separation of racemates prior to reversed-phase HPLC analysis. |
| | (+)-1-(9-Fluorenyl)ethyl chloroformate Preparation Products And Raw materials |
|