| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (R)-(+)-1-(2-Methoxybenzoyl)-2- Basic information |
| | (R)-(+)-1-(2-Methoxybenzoyl)-2- Chemical Properties |
| Melting point | 104-106 °C (lit.) | | Optical Rotation | [α]20/D +91°, c = 1.2 in chloroform | | InChI | 1S/C13H17NO3/c1-17-12-7-3-2-6-11(12)13(16)14-8-4-5-10(14)9-15/h2-3,6-7,10,15H,4-5,8-9H2,1H3/t10-/m1/s1 | | InChIKey | ZPRSXRGRMZPZQY-SNVBAGLBSA-N | | SMILES | COc1ccccc1C(=O)N2CCC[C@@H]2CO |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (R)-(+)-1-(2-Methoxybenzoyl)-2- Usage And Synthesis |
| | (R)-(+)-1-(2-Methoxybenzoyl)-2- Preparation Products And Raw materials |
|