- N-Methyl-D-prolinol
-
- $1.00 / 1KG
-
2019-12-25
- CAS:99494-01-6
- Min. Order: 1IU
- Purity: 99%
- Supply Ability: 100kg
|
| | N-Methyl-D-prolinol Basic information |
| Product Name: | N-Methyl-D-prolinol | | Synonyms: | ((R)-1-methylpyrrolidin-2-yl)methanol;N-METHYL-D-PROLINOL;(R)-1-METHYL-2-PYRROLIDINEMETHANOL;(R)-(-)-(1-METHYL-2-PYRROLIDINYL)METHANOL;[(2R)-1-Methylpyrrolidin-2-yl]Methanol;(R)-2-Hydroxymethyl-1-methylpyrrolidine;1-Methyl-D-prolinol;[(2R)-1-methyl-2-pyrrolidinyl]methanol | | CAS: | 99494-01-6 | | MF: | C6H13NO | | MW: | 115.17 | | EINECS: | | | Product Categories: | | | Mol File: | 99494-01-6.mol |  |
| | N-Methyl-D-prolinol Chemical Properties |
| density | 0.971 g/mL at 25 °C | | refractive index | n20/D4.469 | | Fp | 71℃ | | storage temp. | 2-8°C | | pka | 14.77±0.10(Predicted) | | form | liquid | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | Consistent with structure | | Boiling point | 68-71°C(lit.) | | InChI | InChI=1S/C6H13NO/c1-7-4-2-3-6(7)5-8/h6,8H,2-5H2,1H3/t6-/m1/s1 | | InChIKey | VCOJPHPOVDIRJK-ZCFIWIBFSA-N | | SMILES | N1(C)CCC[C@@H]1CO |
| Hazard Codes | Xn | | Risk Statements | 22-37/38-41 | | Safety Statements | 26-39 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | HS Code | 2933998090 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| | N-Methyl-D-prolinol Usage And Synthesis |
| Uses | N-Methyl-D-prolinol is used as a pharmaceutical or synthetic intermediate component in the preparation of organic compounds such as nitrogen-containing heterocyclic compounds, pyrotinib intermediate and anidulafungin derivative. | | Synthesis | Step 1: Preparation of [(2R)-1-methylpyrrolidin-2-yl]methanol
Lithium aluminum hydride (230 mg, 6 mmol) and N-tert-butoxycarbonyl-R-prolinol (400 mg, 2 mmol) were dissolved in 10 mL of dry tetrahydrofuran and cooled in an ice water bath. After no significant gas release, the reaction mixture was heated to reflux and maintained for 2 hours. Upon completion of the reaction, the mixture was slowly added dropwise to 5 mL of methanol in an ice-water bath, followed by the addition of 5 mL of water. The mixture was dried over anhydrous magnesium sulfate, filtered and concentrated under reduced pressure to afford N-methyl-D-prolinol [(2R)-1-methylpyrrolidin-2-yl]methanol (221 mg, 77.0% yield) as a colorless oil. Mass spectrum (ESI) m/z: 116 [M + 1]. | | References | [1] Patent: US2013/338190, 2013, A1. Location in patent: Paragraph 0037; 0038 [2] Patent: EP2684877, 2014, A2. Location in patent: Page/Page column 0032; 0033 [3] Patent: TWI524893, 2016, B. Location in patent: Page/Page column 44; 45 [4] Patent: WO2018/31877, 2018, A1. Location in patent: Paragraph 00150 |
| | N-Methyl-D-prolinol Preparation Products And Raw materials |
|