(+)-2 2'-ISOPROPYLIDENEBIS((4R)-4-BENZYL manufacturers
|
| | (+)-2 2'-ISOPROPYLIDENEBIS((4R)-4-BENZYL Basic information |
| Product Name: | (+)-2 2'-ISOPROPYLIDENEBIS((4R)-4-BENZYL | | Synonyms: | (4R,4’R)-2,2’-(2,2-Propanediyl)bis(4-benzyl-4,5-dihydrooxazole);2,2-Bis[(4R)-4-benzyl-2-oxazolin-2-yl]propane,99%e.e.;2,2-Bis[(4R)-4-benzyl-2-oxazolin-2-yl]propane, 98%, (99% ee);(4R,4'R)-2,2'-(Propane-2,2-diyl)-bis(4-benzyl-4,5-dihydrooxazole);(+)-2 2'-ISOPROPYLIDENEBIS((4R)-4-BENZYL;(R(R*,R*))-(+)-2,2'-(isopropylidenebis(4-benzyl-2;(R(R*,R*))-(+)-2,2'-(ISOPROPYLIDENEBIS(4;(+)-2,2'-isopropylidenebis[(4r)-4-benzyl-2-oxazoline] | | CAS: | 141362-77-8 | | MF: | C23H26N2O2 | | MW: | 362.46 | | EINECS: | | | Product Categories: | | | Mol File: | 141362-77-8.mol |  |
| | (+)-2 2'-ISOPROPYLIDENEBIS((4R)-4-BENZYL Chemical Properties |
| Melting point | 54-60 °C(lit.) | | Boiling point | 483.2±28.0 °C(Predicted) | | density | 1.15±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 5.63±0.70(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]22/D +65°, c = 1 in ethanol | | InChI | 1S/C23H26N2O2/c1-23(2,21-24-19(15-26-21)13-17-9-5-3-6-10-17)22-25-20(16-27-22)14-18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3/t19-,20-/m1/s1 | | InChIKey | GAKCKAKYRQUVRK-WOJBJXKFSA-N | | SMILES | CC(C)(C1=N[C@@H](CO1)Cc2ccccc2)C3=N[C@@H](CO3)Cc4ccccc4 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (+)-2 2'-ISOPROPYLIDENEBIS((4R)-4-BENZYL Usage And Synthesis |
| Chemical Properties | White ppwder |
| | (+)-2 2'-ISOPROPYLIDENEBIS((4R)-4-BENZYL Preparation Products And Raw materials |
|