| Company Name: |
LaaJoo Gold |
| Tel: |
021-60702684 18516024827 |
| Email: |
huang.jiayi@sinocompound.com |
(S,S)-2,2-Bis(4-phenyl-2-oxazolin-2-yl)propane manufacturers
|
| | (S,S)-2,2-Bis(4-phenyl-2-oxazolin-2-yl)propane Basic information |
| Product Name: | (S,S)-2,2-Bis(4-phenyl-2-oxazolin-2-yl)propane | | Synonyms: | (S,S)-2,2'-(DIMETHYLMETHYLENE)BIS(4-PHENYL-2-OXAZOLINE);(S)-(-)-2,2'-ISOPROPYLIDENEBIS(4-PHENYL-2-OXAZOLINE);(-)-2,2-Bis[(4S)-4-phenyl-2-oxazolin-2-yl]propane,98%;(-)-2,2'-isopropylidenebis[(4s)-4-phenyl-2-oxazoline];2,2'-isopropylidenebis(4-phenyl-2-oxazoline);(S,S)-2,2-Bis(4-phenyl-2-oxazolin-2-yl)propane, (S,S)-2,2μ-Isopropylidenebis(4-phenyl-2-oxazoline);(S,S)-2,2′-Isopropylidene-bis(4-phenyl-2-oxazoline),(S,S)-2,2-Bis(4-phenyl-2-oxazolin-2-yl)propane;()-2,2′-Isopropylidenebis[(4S)-4-phenyl-2-oxazoline],(S,S)-2,2′-Isopropylidenebis(4-phenyl-2-oxazoline), (S,S)-2,2-Bis(4-phenyl-2-oxazolin-2-yl)propane | | CAS: | 131457-46-0 | | MF: | C21H22N2O2 | | MW: | 334.41 | | EINECS: | | | Product Categories: | BOX series;Chiral Nitrogen;organic building block;Asymmetric Synthesis;Synthetic Organic Chemistry;organic amine | | Mol File: | 131457-46-0.mol |  |
| | (S,S)-2,2-Bis(4-phenyl-2-oxazolin-2-yl)propane Chemical Properties |
| Melting point | 37-41 °C(lit.) | | Boiling point | 193 °C0.03 mm Hg(lit.) | | alpha | -150 º (C=1% IN ETOH) | | density | 1 g/mL at 25 °C(lit.) | | refractive index | -155 ° (C=1, EtOH) | | Fp | >230 °F | | storage temp. | -20°C | | form | liquid | | pka | 4.85±0.70(Predicted) | | Appearance | Off-white to light yellow <37°C Solid,>41°C Liquid | | Optical Rotation | [α]20/D 160°, c = 1 in ethanol | | BRN | 4266906 | | InChI | InChI=1S/C21H22N2O2/c1-21(2,19-22-17(13-24-19)15-9-5-3-6-10-15)20-23-18(14-25-20)16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3/t17-,18-/m1/s1 | | InChIKey | JTNVCJCSECAMLD-QZTJIDSGSA-N | | SMILES | C(C1=N[C@@H](C2=CC=CC=C2)CO1)(C1=N[C@@H](C2=CC=CC=C2)CO1)(C)C |
| Risk Statements | 36/37/38 | | Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29349990 | | Storage Class | 10 - Combustible liquids |
| | (S,S)-2,2-Bis(4-phenyl-2-oxazolin-2-yl)propane Usage And Synthesis |
| Chemical Properties | Clear light yellow viscous liquid | | Uses | C2 symmetric ligand for enantioselective catalysis. Easily forms bidentate coordination complexes due to the strong affinity of the oxazoline nitrogen for various metals. |
| | (S,S)-2,2-Bis(4-phenyl-2-oxazolin-2-yl)propane Preparation Products And Raw materials |
|