| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | N-Glycolylneuraminic acid Basic information |
| | N-Glycolylneuraminic acid Chemical Properties |
| Melting point | 188-190°C | | Boiling point | 836.8±65.0 °C(Predicted) | | density | 1.670±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Water (Sparingly) | | form | Solid | | pka | 2.41±0.54(Predicted) | | color | White to Off-White | | biological source | synthetic | | Water Solubility | water: soluble 20mg/mL | | BRN | 1716828 | | InChI | InChI=1S/C11H19NO10/c13-2-5(16)8(18)9-7(12-6(17)3-14)4(15)1-11(21,22-9)10(19)20/h4-5,7-9,13-16,18,21H,1-3H2,(H,12,17)(H,19,20)/t4-,5+,7+,8+,9+,11-/m0/s1 | | InChIKey | FDJKUWYYUZCUJX-AJKRCSPLSA-N | | SMILES | C(O)(=O)[C@@]1(C[C@H](O)[C@@H](NC(CO)=O)[C@H]([C@@H]([C@@H](CO)O)O)O1)O | | CAS DataBase Reference | 1113-83-3(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | F | 10 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids |
| | N-Glycolylneuraminic acid Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | Regulation of N-glycolylneuraminic acid biosynthesis in rat and mouse liver. | | Uses | Glycolylneuraminic acid, a component of non-human milk and colostrums, is used as a reference to analyse changes of the glycome during lactation. Glycolylneuraminic acid, a xenoantigen, is involved in antigenic reactions (antibody-mediated hyperacute rejection) during xenotransplantion. | | Definition | ChEBI: An N-acylneuraminic acid in which the acyl substituent on nitrogen is glycolyl and which has beta-configuration at the anomeric centre. | | Biological Activity | N-Glycolylneuraminic acid (Neu5Gc) functions as an important tool for profiling anti-Neu5Gc antibodies and sialic acid-binding proteins. |
| | N-Glycolylneuraminic acid Preparation Products And Raw materials |
|