Barium dihydrogen phosphate manufacturers
- BariumDihydrogenPhosphate
-
-
2025-06-20
- CAS:13466-20-1
- Min. Order: 1kg
- Purity: 99%;BaO:46%±0.5%,P2O5:43%±0.5%
- Supply Ability: 100tons
|
| | Barium dihydrogen phosphate Basic information |
| Product Name: | Barium dihydrogen phosphate | | Synonyms: | Bariumdihydrogenphosphate;Phosphoricacid,bariumsalt(2:1);barium bis(dihydrogenorthophosphate);DihydrogenBariumPhosphate;MONO BARIUM PHOSPHATE;Barium dihydrogen phosphate, prim-Barium phosphate;Einecs 236-715-1;prim-Barium phosphate | | CAS: | 13466-20-1 | | MF: | BaH4O8P2 | | MW: | 331.301482 | | EINECS: | 236-715-1 | | Product Categories: | | | Mol File: | 13466-20-1.mol |  |
| | Barium dihydrogen phosphate Chemical Properties |
| Melting point | 1560℃ [ALF93] | | density | 2.983[at 20℃] | | solubility | insoluble in H2O; slightly soluble in acid solutions | | form | powder | | color | white | | Water Solubility | insoluble H2O; slowly dissolves in acids [HAW93] | | InChI | InChI=1S/Ba.2H3O4P/c;2*1-5(2,3)4/h;2*(H3,1,2,3,4)/q+2;;/p-2 | | InChIKey | IOPOLWHQYJSKCT-UHFFFAOYSA-L | | SMILES | P(=O)(O)(O)[O-].P([O-])(=O)(O)O.[Ba+2] | | EPA Substance Registry System | Phosphoric acid, barium salt (2:1) (13466-20-1) |
| Hazard Codes | Xn | | Risk Statements | 20/22 | | Safety Statements | 28 | | RIDADR | 1564 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III |
| | Barium dihydrogen phosphate Usage And Synthesis |
| Chemical Properties | white powder(s); used in glasses, porcelain, and enamel [HAW93] | | Flammability and Explosibility | Not classified |
| | Barium dihydrogen phosphate Preparation Products And Raw materials |
|