|
|
| | N(ALPHA) N-(IM)-DI-BOC-L-HISTIDINE Basic information |
| Product Name: | N(ALPHA) N-(IM)-DI-BOC-L-HISTIDINE | | Synonyms: | tert-butyl 4-[(2S)-2-{[(tert-butoxy)carbonyl]amino}-3-methoxy-3-oxopropyl]-1H-imidazole-1-carboxylate;[Methyl(S)-3[1-(1,1-dimethylethoxycarbonyl)-1-H-imidazol-4-yl]-2-[(1,1-dimethylethoxycarbonyl)amino]propionate];Na,N-(im)-Di-BOC-L-histidinemethylester;[methyl(s)-3[1-(1,1-dimethylethoxycarbonyl)-1-h-imidaral-4-yl]-2-[(1,1-dimethylethoxycarbonyl)amino]propionate];n(α), n-(im)-di-boc-l-histidine methyl ester;N(alpha), N-(im)-Di-Boc-L-histidine methyl ester 97%;Boc-L-His(Boc)-OMe;Nα,Nim-Bis-Boc-L-histidine methyl ester99% | | CAS: | 17791-51-4 | | MF: | C17H27N3O6 | | MW: | 369.41 | | EINECS: | | | Product Categories: | | | Mol File: | 17791-51-4.mol |  |
| | N(ALPHA) N-(IM)-DI-BOC-L-HISTIDINE Chemical Properties |
| Melting point | 113-116 °C (lit.) | | density | 1.177±0.14 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | 2-8°C | | pka | 10.846±0.46(predicted) | | Major Application | peptide synthesis | | InChI | 1S/C17H27N3O6/c1-16(2,3)25-14(22)19-12(13(21)24-7)8-11-9-20(10-18-11)15(23)26-17(4,5)6/h9-10,12H,8H2,1-7H3,(H,19,22)/t12-/m0/s1 | | InChIKey | ZYCZFTGHOVFXLZ-LBPRGKRZSA-N | | SMILES | COC(=O)[C@H](Cc1cn(cn1)C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | N(ALPHA) N-(IM)-DI-BOC-L-HISTIDINE Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | N(ALPHA) N-(IM)-DI-BOC-L-HISTIDINE Preparation Products And Raw materials |
|