4-BENZYLOXY-3-CHLOROANILINE 96 manufacturers
|
| | 4-BENZYLOXY-3-CHLOROANILINE 96 Basic information |
| | 4-BENZYLOXY-3-CHLOROANILINE 96 Chemical Properties |
| Melting point | 56-60 °C (lit.) | | Boiling point | 390.6±27.0 °C(Predicted) | | density | 1.240±0.06 g/cm3(Predicted) | | form | solid | | pka | 4.10±0.10(Predicted) | | InChI | 1S/C13H12ClNO/c14-12-8-11(15)6-7-13(12)16-9-10-4-2-1-3-5-10/h1-8H,9,15H2 | | InChIKey | WOWKZTBVWKKGJV-UHFFFAOYSA-N | | SMILES | Nc1ccc(OCc2ccccc2)c(Cl)c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-BENZYLOXY-3-CHLOROANILINE 96 Usage And Synthesis |
| Uses | 4-Benzyloxy-3-chloroaniline is a compound used in the preparation of potent and selective inhibitors for UBLCP1 proteasome phosphatase. |
| | 4-BENZYLOXY-3-CHLOROANILINE 96 Preparation Products And Raw materials |
|