| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(2 4-Dichlorophenoxy)benzaldehyde 97 Basic information |
| | 4-(2 4-Dichlorophenoxy)benzaldehyde 97 Chemical Properties |
| Melting point | 50-54 °C | | Boiling point | 360.1±37.0 °C(Predicted) | | density | 1.365±0.06 g/cm3(Predicted) | | Fp | >230 °F | | form | solid | | InChI | 1S/C13H8Cl2O2/c14-10-3-6-13(12(15)7-10)17-11-4-1-9(8-16)2-5-11/h1-8H | | InChIKey | URLOSHBYGSZBLL-UHFFFAOYSA-N | | SMILES | [H]C(=O)c1ccc(Oc2ccc(Cl)cc2Cl)cc1 |
| Hazard Codes | Xn,N | | Risk Statements | 22-41-43-50/53 | | Safety Statements | 26-36/37/39-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Sens. 1 |
| | 4-(2 4-Dichlorophenoxy)benzaldehyde 97 Usage And Synthesis |
| | 4-(2 4-Dichlorophenoxy)benzaldehyde 97 Preparation Products And Raw materials |
|