Azido-PEG7-acid manufacturers
- N3-PEG7-CH2COOH
-
-
2026-07-24
- CAS:1446411-32-0
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 1g/bottle, 10g/bottle, 100g/bottle
|
| | Azido-PEG7-acid Basic information |
| Product Name: | Azido-PEG7-acid | | Synonyms: | N3-PEG7-CH2COOH/3,6,9,12,15,18,21-Heptaoxatricosanoic acid, 23-azido-;23-Azido-3,6,9,12,15,18,21-heptaoxatricosan-1-oic Acid;N3-PEG7-CH2COOH | | CAS: | 1446411-32-0 | | MF: | C16H31N3O9 | | MW: | 409.44 | | EINECS: | | | Product Categories: | | | Mol File: | 1446411-32-0.mol |  |
| | Azido-PEG7-acid Chemical Properties |
| InChI | InChI=1S/C16H31N3O9/c17-19-18-1-2-22-3-4-23-5-6-24-7-8-25-9-10-26-11-12-27-13-14-28-15-16(20)21/h1-15H2,(H,20,21) | | InChIKey | OHDHUWBOUOIMHQ-UHFFFAOYSA-N | | SMILES | O(CCOCCOCC(=O)O)CCOCCOCCOCCOCCN=[N+]=[N-] |
| | Azido-PEG7-acid Usage And Synthesis |
| Uses | Azido-PEG7-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. Azido-PEG7-CH2COOH is a click chemistry reagent, it contains an Azide group and can undergo copper-catalyzed azide-alkyne cycloaddition reaction (CuAAc) with molecules containing Alkyne groups. It can also undergo strain-promoted alkyne-azide cycloaddition (SPAAC) reactions with molecules containing DBCO or BCN groups. | | Biological Activity | Azido-PEG7-CH2COOH is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1].
PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. | | IC 50 | PEGs | | References | [1]. An S, et al. Small-molecule PROTACs: An emerging and promising approach for the development of targeted therapy drugs. EBioMedicine. 2018 Oct;36:553-562 |
| | Azido-PEG7-acid Preparation Products And Raw materials |
|