| Company Name: |
NewCan Biotech Limited
|
| Tel: |
+86-0571-86912261 +86-15658003402 |
| Email: |
sales@newcanbio.com |
| Products Intro: |
Product Name:N6-[(5-Bromothien-2-yl)methyl]adenosine CAS:1706525-09-8 Purity:98% Package:mgs,gs,kgs
|
| Company Name: |
Zhengzhou Chemprize Biotech Co., Ltd.
|
| Tel: |
15981919713 15981919713 |
| Email: |
sales@nucleosides.com |
| Products Intro: |
Product Name:N6-[(5-Bromothien-2-yl)methyl]adenosine CAS:1706525-09-8 Purity:95% Package:1g;5g;10g;100g
|
| Company Name: |
Shanghai meikai technology co., ltd
|
| Tel: |
021-68689288 15300790979 |
| Email: |
info@mkbio.com.cn |
| Products Intro: |
Product Name:N6-[(5-Bromothien-2-yl)methyl]adenosine CAS:1706525-09-8 Purity:98% Package:25 mg/1725;100 mg/3881.25;/0
|
|
| | N6-[(5-Bromothien-2-yl)methyl]adenosine Basic information |
| | N6-[(5-Bromothien-2-yl)methyl]adenosine Chemical Properties |
| InChIKey | NMCXSKQZGXWJCZ-PMXXHBEXSA-N | | SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=CN=3)NCC3SC(Br)=CC=3)N=C2)[C@H](O)[C@@H]1O |
| | N6-[(5-Bromothien-2-yl)methyl]adenosine Usage And Synthesis |
| Uses | N6-[(5-Bromothien-2-yl)methyl]adenosine can be used as organic synthesis intermediate and pharmaceutical intermediate, mainly used in laboratory research and development process and chemical production process. |
| | N6-[(5-Bromothien-2-yl)methyl]adenosine Preparation Products And Raw materials |
|