| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1,3-Diphenylacetone p-toluenesulfonylhydrazone Basic information |
| Product Name: | 1,3-Diphenylacetone p-toluenesulfonylhydrazone | | Synonyms: | RARECHEM AQ A2 0069;SALOR-INT L498351-1EA;1,3-DIPHENYLACETONE P-TOLUENESULPHONYLHYDRAZONE;1,3-DIPHENYLACETONE P-TOSYLHYDRAZONE;1,3-DIPHENYL-2-PROPANONE P-TOSYLHYDRAZONE;1,3-DIPHENYL-2-PROPANONE TOSYLHYDRAZONE;LABOTEST-BB LT00239230;1,3-diphenylpropan-2-one tosylhydrazone | | CAS: | 19816-88-7 | | MF: | C22H22N2O2S | | MW: | 378.49 | | EINECS: | 243-344-9 | | Product Categories: | | | Mol File: | 19816-88-7.mol |  |
| | 1,3-Diphenylacetone p-toluenesulfonylhydrazone Chemical Properties |
| Melting point | 186-187 °C | | Boiling point | 555.2±60.0 °C(Predicted) | | density | 1.1430 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | chloroform: 25mg/mL, clear, orange | | form | powder to crystal | | pka | 10.29±0.40(Predicted) | | color | White to Almost white | | BRN | 2225293 | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C22H22N2O2S/c1-18-12-14-22(15-13-18)27(25,26)24-23-21(16-19-8-4-2-5-9-19)17-20-10-6-3-7-11-20/h2-15,24H,16-17H2,1H3 | | InChIKey | GDXUEUWCUUAZFM-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)S(=O)(=O)N\N=C(\Cc2ccccc2)Cc3ccccc3 | | CAS DataBase Reference | 19816-88-7(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | HS Code | 2928.00.5000 | | Storage Class | 11 - Combustible Solids |
| | 1,3-Diphenylacetone p-toluenesulfonylhydrazone Usage And Synthesis |
| Chemical Properties | white to light yellow crystalline powder | | Uses | diagnostic assay manufacturing hematology histology |
| | 1,3-Diphenylacetone p-toluenesulfonylhydrazone Preparation Products And Raw materials |
|