|
|
| | Calcium phenylpyruvate Basic information |
| Product Name: | Calcium phenylpyruvate | | Synonyms: | Calcium phenylpyruvate (calcium salt);CALCIUM ALPHA-KETO-BETA-PHENYLPROPIONATE;CALCIUM PHENYLPYRUVATE;Benzenepropanoic acid, a-oxo-, calcium salt;Calcium-2-Oxo-3-Phenylpropionate (Calcium Phenylpyruvate);alpha-Ketophenylalanine calcium salt
Calcium bis(3-phenylpyruvate);Bis(α-oxobenzenepropanoic acid)calcium salt;CalciuM 2-oxo-3-phenylpropanoate | | CAS: | 51828-93-4 | | MF: | C9H10CaO3 | | MW: | 206.25 | | EINECS: | 257-455-5 | | Product Categories: | | | Mol File: | 51828-93-4.mol |  |
| | Calcium phenylpyruvate Chemical Properties |
| Melting point | 172°C (dec.) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly) | | form | Solid | | color | White to Off-White | | Stability: | Hygroscopic | | InChI | InChI=1S/C9H8O3.Ca.2H/c10-8(9(11)12)6-7-4-2-1-3-5-7;;;/h1-5H,6H2,(H,11,12);;; | | InChIKey | GGCFWYGFZXNWIE-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)C(=O)C(=O)O.[Ca] | | CAS DataBase Reference | 51828-93-4(CAS DataBase Reference) |
| | Calcium phenylpyruvate Usage And Synthesis |
| Description | Calcium phenylpyruvate, chemically known as calcium 2-oxo-3-phenylpropanoate, is one of the main ingredients in compound α-keto acid tablets. These tablets treat chronic renal failure (CRF) and disorders related to protein metabolism due to renal insufficiency. They help protect against and relieve renal damage while delaying the onset of dialysis. | | Uses | Calcium phenylpyruvate is utilized in the process of preparing sodium phenylpyruvate. | | Preparation | The main methods for synthesizing α-ketophenylalanine are: the synthesis method of hydantoin and benzaldehyde, namely the hydantoin method, the hydrolysis method of α-acetylaminocinnamic acid and the dicarbonylation method. Its calcium salt can be directly prepared by the action of a catalyst. |
| | Calcium phenylpyruvate Preparation Products And Raw materials |
|