| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | COENZYME Q4 Basic information |
| Product Name: | COENZYME Q4 | | Synonyms: | COENZYME Q4;2,3-DIMETHOXY-5-METHYL-6-(GERANYLGERANYL)-1,4-BENZOQUINONE;Q-4;UBIQUINONE-20;UBIQUINONE-4;2,3-dimethoxy-5-methyl-6-[(2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl]cyclohexa-2,5-diene-1,4-dione;Ubiquinone Q4;2,3-Dimethoxy-5-methyl-6-(geranylgeranyl)-1,4-benzoquinone, Q-4, Ubiquinone-20, Ubiquinone-4 | | CAS: | 4370-62-1 | | MF: | C29H42O4 | | MW: | 454.64 | | EINECS: | 215-668-0 | | Product Categories: | | | Mol File: | 4370-62-1.mol |  |
| | COENZYME Q4 Chemical Properties |
| Boiling point | 584.1±50.0 °C(Predicted) | | density | 1.01±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | form | Liquid | | color | Colorless to light yellow | | BRN | 2066531 | | InChIKey | MDLQEORKYVBTDV-INVBOZNNSA-N | | SMILES | COC1C(OC)C(=O)C(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)CC\C=C(\C)C)=C(C)C1=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 8-10 | | Storage Class | 10 - Combustible liquids |
| | COENZYME Q4 Usage And Synthesis |
| Uses | Coenzyme Q4 (CoQ4) is a 4 isoprenyl group member of a family of ubiquinones that share a quinine chemical group but differ in the number of isoprenyl chemical subunits in their tail. The CoQ compounds are lipid soluble components of cell membranes where they perform multiple functions such as electron and proton transport. The most well studied CoQ compound is CoQ10. CoQ4 is frequently used in comparison studies on the effect of isoprenyl chain length on CoQ functions or distribution. | | Definition | ChEBI: Coenzyme Q4 is a member of ubiquinones. | | Biochem/physiol Actions | Increases the fluorescence polarization of perylene incorporated into ubiquinone-depleted mitochondrial and bilayer vesicles prepared from mitochondrial phospholipids | | Purification Methods | It is a redoil which can be purified by chromatography on SiO2 plates and eluted with Et2O/hexane. The purity is checked by HPLC (silica column using 7% Et2O/hexane). It has max 270 nm ( 14,800) in pet ether. [NMR and MS: Naruta J Org Chem 45 4097 1980, cf Morton Biochemical Spectroscopy (Adam Hilger, London, 1975) p 491]. It has also been dissolved in MeOH/EtOH (1:1 v/v) and kept at 5o until crystals appear [Lester & Crane Biochim Biophys Acta 32 497 1958]. |
| | COENZYME Q4 Preparation Products And Raw materials |
|