| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 4-(Trifluoromethyl)phenylglycine Basic information |
| Product Name: | 4-(Trifluoromethyl)phenylglycine | | Synonyms: | (2S)-amino[4-(trifluoromethyl)phenyl]acetic acid;(2S)-2-AMINO-2-[4-(TRIFLUOROMETHYL)PHENYL]ACETIC ACID;4-(Trifluoromethyl)-L-phenylglycine >=98.0%;4-(TRIFLUOROMETHYL)-L-PHENYLGLYCINE;(S)-AMINO-(4-TRIFLUOROMETHYL-PHENYL)-ACETIC ACID;(S)-2-AMINO-2-[4-(TRIFLUOROMETHYL)PHENYL]ACETIC ACID;Benzeneacetic acid, a-amino-4-(trifluoromethyl)-, (aS)-;(2S)-2-ammonio-2-[4-(trifluoromethyl)phenyl]acetate | | CAS: | 144789-75-3 | | MF: | C9H8F3NO2 | | MW: | 219.16 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 144789-75-3.mol |  |
| | 4-(Trifluoromethyl)phenylglycine Chemical Properties |
| Boiling point | 297.239±40.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.416±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Store at Room Tem. | | pka | 1.653±0.10(predicted) | | Major Application | peptide synthesis | | InChI | 1S/C9H8F3NO2/c10-9(11,12)6-3-1-5(2-4-6)7(13)8(14)15/h1-4,7H,13H2,(H,14,15)/t7-/m0/s1 | | InChIKey | FANMQHUKZBBELZ-ZETCQYMHSA-N | | SMILES | N[C@H](C(O)=O)c1ccc(cc1)C(F)(F)F |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 4-(Trifluoromethyl)phenylglycine Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | 4-(Trifluoromethyl)phenylglycine Preparation Products And Raw materials |
|