| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | (S)-N-Benzyl-1-(1-naphthyl)ethylamine hydrochloride Basic information |
| Product Name: | (S)-N-Benzyl-1-(1-naphthyl)ethylamine hydrochloride | | Synonyms: | (S)-N-[1-(1-NAPHTHYL)ETHYL]BENZYLAMINE HYDROCHLORIDE;(S)-N-BENZYL-1-(1-NAPHTHYL)ETHYLAMINE &;(S)-N-Benzyl-1-(naphthalen-1-yl)ethanaMine hydrochloride;(S)-N-[1-(1-Naphthyl)ethyl]benzylamine hydrochloride, (S)-N-Benzyl-1-(1-naphthyl)ethylamine hydrochloride;(S)-N-benzyl-1-(naphthalen-1-yl)ethan-1-amine hydrochloride;Cinacalcet Impurity 102;(S)-N-Benzyl-1-(1-naphthyl)ethylamine hydrochloride >=96.0%;(S)-N-Benzyl-1-(1-naphthyl)ethylamine hydrochloride | | CAS: | 163831-66-1 | | MF: | C19H20ClN | | MW: | 297.83 | | EINECS: | | | Product Categories: | | | Mol File: | 163831-66-1.mol |  |
| | (S)-N-Benzyl-1-(1-naphthyl)ethylamine hydrochloride Chemical Properties |
| Melting point | 259-261 °C(lit.) | | form | powder | | Optical Rotation | [α]20/D +61±2°, c = 2% in methanol | | InChI | 1S/C19H19N.ClH/c1-15(20-14-16-8-3-2-4-9-16)18-13-7-11-17-10-5-6-12-19(17)18;/h2-13,15,20H,14H2,1H3;1H/t15-;/m0./s1 | | InChIKey | KCLJDAVYFCDIDY-RSAXXLAASA-N | | SMILES | Cl.C[C@H](NCc1ccccc1)c2cccc3ccccc23 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | (S)-N-Benzyl-1-(1-naphthyl)ethylamine hydrochloride Usage And Synthesis |
| | (S)-N-Benzyl-1-(1-naphthyl)ethylamine hydrochloride Preparation Products And Raw materials |
|