|
|
| | 4,4'-METHYLENEBIS(2,6-DIISOPROPYLANILINE) Basic information |
| Product Name: | 4,4'-METHYLENEBIS(2,6-DIISOPROPYLANILINE) | | Synonyms: | LABOTEST-BB LT00160073;LONZACURE(R) M-DIPA;4,4’-methylenebis[2,6-bis(1-methylethyl)-benzenamin;4 4'-METHYLENEBIS(2 6-DIISOPROPYLANILIN;4,4-DIAMINO-3,35,5 -TETRAISOPROPYLDIPHENYLMETHANE(TIPDDM);4-[(4-aminophenyl)methyl]-2,6-di(propan-2-yl)aniline;4,4-methylenebis(2,6-diisopropylaniline) (M-DIPA);4,4'-Methylenebis(2,6-diisopropylaniline),90-95% | | CAS: | 19900-69-7 | | MF: | C25H38N2 | | MW: | 366.58 | | EINECS: | 243-421-7 | | Product Categories: | | | Mol File: | 19900-69-7.mol |  |
| | 4,4'-METHYLENEBIS(2,6-DIISOPROPYLANILINE) Chemical Properties |
| Melting point | 10-30 °C | | Boiling point | 215-218 °C (0.5 mmHg) | | density | 0.99 | | vapor pressure | 0Pa at 25℃ | | refractive index | 1.7620 (estimate) | | Fp | 113 °C | | storage temp. | 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.99±0.25(Predicted) | | color | Light Beige to Brown | | Water Solubility | 488ng/L at 23℃ | | InChI | InChI=1S/C25H38N2/c1-14(2)20-10-18(11-21(15(3)4)24(20)26)9-19-12-22(16(5)6)25(27)23(13-19)17(7)8/h10-17H,9,26-27H2,1-8H3 | | InChIKey | KZTROCYBPMKGAW-UHFFFAOYSA-N | | SMILES | C(C1=CC(C(C)C)=C(N)C(C(C)C)=C1)C1=CC(C(C)C)=C(N)C(C(C)C)=C1 | | LogP | 5.68 at 23.3℃ | | EPA Substance Registry System | Benzenamine, 4,4'-methylenebis[2,6-bis(1-methylethyl)- (19900-69-7) |
| Provider | Language |
|
ACROS
| English |
| | 4,4'-METHYLENEBIS(2,6-DIISOPROPYLANILINE) Usage And Synthesis |
| Chemical Properties | 4,4'-METHYLENEBIS(2,6-DIISOPROPYLANILINE) is solidified melt | | Uses | 4,4'-METHYLENEBIS(2,6-DIISOPROPYLANILINE) is an excellent chain extender for elastomeric polyurethanes (PU) especially useful in systems cured at room temperature. It is also a curing agent for epoxides (EP) and an intermediate for organic syntheses. | | Flammability and Explosibility | Non flammable |
| | 4,4'-METHYLENEBIS(2,6-DIISOPROPYLANILINE) Preparation Products And Raw materials |
|