| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-[4-(Trifluoromethyl)phenyl]-2-thiourea Basic information |
| | 1-[4-(Trifluoromethyl)phenyl]-2-thiourea Chemical Properties |
| Melting point | 142-146 °C | | Boiling point | 269.9±50.0 °C(Predicted) | | density | 1.457±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 12.33±0.70(Predicted) | | color | Off-White to Pale Brown | | BRN | 2695479 | | InChI | 1S/C8H7F3N2S/c9-8(10,11)5-1-3-6(4-2-5)13-7(12)14/h1-4H,(H3,12,13,14) | | InChIKey | OWTDDZMFRLUBQI-UHFFFAOYSA-N | | SMILES | NC(=S)Nc1ccc(cc1)C(F)(F)F | | CAS DataBase Reference | 1736-72-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38-43 | | Safety Statements | 26-36/37 | | RIDADR | 2811 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2930909899 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 1-[4-(Trifluoromethyl)phenyl]-2-thiourea Usage And Synthesis |
| Uses | [4-(Trifluoromethyl)phenyl]thiourea is a reagent used in the synthesis of pharmaceuticals such as thiourea analogs as inhibitors of UT-A and UT-B transporters as well as 2-aminothiazole sphingosine inhibitors. |
| | 1-[4-(Trifluoromethyl)phenyl]-2-thiourea Preparation Products And Raw materials |
|