| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 4-Bromo-2-(trifluoromethyl)phenylthiourea Basic information |
| | 4-Bromo-2-(trifluoromethyl)phenylthiourea Chemical Properties |
| Melting point | 176-181 °C | | form | solid | | InChI | 1S/C8H6BrF3N2S/c9-4-1-2-6(14-7(13)15)5(3-4)8(10,11)12/h1-3H,(H3,13,14,15) | | InChIKey | HXTGSKARZANHPM-UHFFFAOYSA-N | | SMILES | NC(=S)Nc1ccc(Br)cc1C(F)(F)F |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36/37 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Harmful | | HazardClass | IRRITANT | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2930909899 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 4-Bromo-2-(trifluoromethyl)phenylthiourea Usage And Synthesis |
| | 4-Bromo-2-(trifluoromethyl)phenylthiourea Preparation Products And Raw materials |
|