Bis-(4-dimethylaminophenyl)phenyl-d5-methane manufacturers
|
| | Bis-(4-dimethylaminophenyl)phenyl-d5-methane Basic information |
| Product Name: | Bis-(4-dimethylaminophenyl)phenyl-d5-methane | | Synonyms: | LMG-D5;D5-LEUCO-MALACHITE GREEN;Bis-(4-dimethylaminophenyl)phenyl-d5-methane, LMG-D5;LeucoMalachite green-D5 (LMG-D5);4-[[4-(dimethylamino)phenyl]-(2,3,4,5,6-pentadeuteriophenyl)methyl]-N,N-dimethylaniline;Leucomalachite green-d5 Solution, 100μg/mL;Benzenamine, 4,4'-(phenyl-2,3,4,5,6-d5-methylene)bis[N,N-dimethyl-;4,4'-((Phenyl-d5)methylene)bis(N,N-dimethylaniline) | | CAS: | 947601-82-3 | | MF: | C23H21D5N2 | | MW: | 335.5 | | EINECS: | | | Product Categories: | Amines;Aromatics;Isotope Labelled Compounds | | Mol File: | 947601-82-3.mol |  |
| | Bis-(4-dimethylaminophenyl)phenyl-d5-methane Chemical Properties |
| Melting point | 100 - 104°C | | storage temp. | Refrigerator, Under inert atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly) | | form | solid | | color | White to Off-White | | Major Application | cleaning products
cosmetics
environmental
food and beverages
personal care | | InChI | 1S/C23H26N2/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4/h5-17,23H,1-4H3/i5D,6D,7D,8D,9D | | InChIKey | WZKXBGJNNCGHIC-CFEWMVNUSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C(c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
Muta. 2 |
| | Bis-(4-dimethylaminophenyl)phenyl-d5-methane Usage And Synthesis |
| Uses | A labelled metabolite of Malachite Green in seafood products. A labelled triphenylmethane dye with fungicidal and limited antiseptic activity. The term Malachine green applies to the oxalate as well as the chloride. Harmful if swallowed. Avoid release to the environment. |
| | Bis-(4-dimethylaminophenyl)phenyl-d5-methane Preparation Products And Raw materials |
|