|
|
| | 1-Bromodecane-10,10,10-d3 Basic information |
| | 1-Bromodecane-10,10,10-d3 Chemical Properties |
| Boiling point | 238 °C(lit.) | | density | 1.080 g/mL at 25 °C | | Fp | 94 °C | | InChI | 1S/C10H21Br/c1-2-3-4-5-6-7-8-9-10-11/h2-10H2,1H3/i1D3 | | InChIKey | MYMSJFSOOQERIO-FIBGUPNXSA-N | | SMILES | [2H]C([2H])([2H])CCCCCCCCCBr |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | 1-Bromodecane-10,10,10-d3 Usage And Synthesis |
| Uses | 1-Bromodecane-10,10,10-d3 (CAS# 284474-47-1) is a useful isotopically labeled research compound. |
| | 1-Bromodecane-10,10,10-d3 Preparation Products And Raw materials |
|