| Company Name: |
cuicheng bio Gold |
| Tel: |
13186333400 |
| Email: |
m13108465082@163.com |
| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
Arecaidine hydrochloride manufacturers
|
| | Arecaidine hydrochloride Basic information |
| Product Name: | Arecaidine hydrochloride | | Synonyms: | 1-METHYL-1,2,5,6-TETRAHYDROPYRIDINE-3-CARBOXYLIC ACID HYDROCHLORIDE;1,2,5,6-TETRAHYDRO-1-METHYL-NICOTINIC ACID HYDROCHLORIDE;RARECHEM AX KI 5012;1,2,5,6-tetrahydro-1-methyl-3-pyridinecarboxylicacihydrochloride;1,2,5,6-tetrahydro-1-methyl-nicotinicacihydrochloride;1-Methyl-1,2,5,6-tetrahydronicotinic acid hydrochloride;1-Methyl-1,2,5,6-tetrahydronicotinicacidHCl;1,2,5,6-tetrahydro-1-methylnicotinic acid | | CAS: | 6018-28-6 | | MF: | C7H12ClNO2 | | MW: | 177.63 | | EINECS: | | | Product Categories: | Carboxylic Acids;Pyrans, Piperidines &Piperazines;Carboxylic Acids;Pyrans, Piperidines & Piperazines | | Mol File: | 6018-28-6.mol |  |
| | Arecaidine hydrochloride Chemical Properties |
| Melting point | 260°C | | storage temp. | Inert atmosphere,2-8°C | | form | Solid | | color | White to light yellow | | Merck | 14,777 | | BRN | 3913792 | | Major Application | food and beverages
pharmaceutical | | InChI | InChI=1S/C7H11NO2.ClH/c1-8-4-2-3-6(5-8)7(9)10;/h3H,2,4-5H2,1H3,(H,9,10);1H | | InChIKey | PIVDNPNYIBGXPL-UHFFFAOYSA-N | | SMILES | C1(C(=O)O)=CCCN(C)C1.Cl |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | RTECS | QT2087000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | Arecaidine hydrochloride Usage And Synthesis |
| Chemical Properties | Flaky crystals, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from the seeds of Areca catechu L., a palm plant. | | Uses | Arecaidine Hydrochloride is a reactant used for the synthesis of dienone Elaeocarpus alkaloids. |
| | Arecaidine hydrochloride Preparation Products And Raw materials |
|