|
|
| | 1,3-Bis(trifluoromethyl)-benzene Basic information |
| Product Name: | 1,3-Bis(trifluoromethyl)-benzene | | Synonyms: | ALPHA,ALPHA,ALPHA,ALPHA',ALPHA',ALPHA'-HEXAFLUORO-M-XYLENE;A,A,A,A',A',A'-HEXAFLUORO-M-XYLENE;alpha,alpha,alpha,beta,beta,beta-hexafluoro-m-xylene;1,3-TrifluoromethylBenzene;1,3-Bis(trifluoromethyl)benzene, 98+%;M-BIS(TRIFLUORO-METNY)BENZENE;m-Ditrifluorotoluene;à,à,à,à',à',à'-hexafluoro-m-xylene | | CAS: | 402-31-3 | | MF: | C8H4F6 | | MW: | 214.11 | | EINECS: | 206-939-4 | | Product Categories: | Aromatic Hydrocarbons (substituted) & Derivatives;Benzene derivatives | | Mol File: | 402-31-3.mol |  |
| | 1,3-Bis(trifluoromethyl)-benzene Chemical Properties |
| Melting point | -35°C | | Boiling point | 116-116.3 °C(lit.) | | density | 1.378 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.379(lit.) | | Fp | 26 °C | | storage temp. | Sealed in dry,2-8°C | | form | clear liquid | | Specific Gravity | 1.378 | | color | Colorless to Light yellow to Light orange | | Water Solubility | Insoluble in water. Soluble in alcohol, ether, benzene. | | BRN | 2052589 | | Dielectric constant | 5.9800000000000004 | | InChI | 1S/C8H4F6/c9-7(10,11)5-2-1-3-6(4-5)8(12,13)14/h1-4H | | InChIKey | SJBBXFLOLUTGCW-UHFFFAOYSA-N | | SMILES | FC(F)(F)c1cccc(c1)C(F)(F)F | | LogP | 3.83 | | CAS DataBase Reference | 402-31-3(CAS DataBase Reference) | | NIST Chemistry Reference | Benzene, 1,3-bis(trifluoromethyl)-(402-31-3) | | EPA Substance Registry System | Benzene, 1,3-bis(trifluoromethyl)- (402-31-3) |
| Hazard Codes | Xi,F | | Risk Statements | 10-36/37/38 | | Safety Statements | 26-24/25 | | RIDADR | UN 1993 3/PG 3 | | WGK Germany | 3 | | Hazard Note | Flammable | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | III | | HS Code | 29039990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| | 1,3-Bis(trifluoromethyl)-benzene Usage And Synthesis |
| Chemical Properties | CLEAR COLOURLESS LIQUID | | Uses | 1,3-Bis(trifluoromethyl)benzene undergoes regioselective metalation and subsequent carboxylation at position 2 to give 2,6-bis(trifluoromethyl)benzoic acid. a convenient, selective synthesis of bis[2,4-bis(trifluoromethyl)phenyl]phosphane derivatives with 1,3-bis(trifluoromethyl)benzene as starting material. | | General Description | Lithiation reaction of 1,3-bis(trifluoromethyl)benzene has been investigated. 1,3-Bis(trifluoromethyl)benzene undergoes regioselective metalation and subsequent carboxylation at position 2 to give 2,6-bis(trifluoromethyl)benzoic acid. |
| | 1,3-Bis(trifluoromethyl)-benzene Preparation Products And Raw materials |
|