|
|
| | 1-(CHLOROMETHYL)-1H-BENZOTRIAZOLE Basic information |
| | 1-(CHLOROMETHYL)-1H-BENZOTRIAZOLE Chemical Properties |
| Melting point | 136-139 °C(lit.) | | Boiling point | 305.9±25.0 °C(Predicted) | | density | 1.42±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder to crystal | | pka | 1.13±0.30(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C7H6ClN3/c8-5-11-7-4-2-1-3-6(7)9-10-11/h1-4H,5H2 | | InChIKey | VSEROABGEVRIRY-UHFFFAOYSA-N | | SMILES | N1(CCl)C2=CC=CC=C2N=N1 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | HS Code | 2933.99.8290 | | HazardClass | 8 | | PackingGroup | II |
| | 1-(CHLOROMETHYL)-1H-BENZOTRIAZOLE Usage And Synthesis |
| Uses | 1-(Chloromethyl)-1H-benzotriazole can be used as a reactant:
- In Gewald cyclocondensation reactions.
- To prepare N-(benzotriazol-1-ylmethyl) heterocycles by reacting with nitrogen heterocycles.
- To synthesize palladium complexes for applications in Heck and Suzuki-Miyaura C-C coupling reactions.
- In the synthesis of 2,3-disubstituted benzofurans by treating with o-hydroxyphenyl ketones.
| | reaction suitability | reaction type: C-C Bond Formation |
| | 1-(CHLOROMETHYL)-1H-BENZOTRIAZOLE Preparation Products And Raw materials |
|