| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | PIPERAZINE-2,2,3,3,5,5,6,6-D8 DIHYDROCHLORIDE Basic information |
| Product Name: | PIPERAZINE-2,2,3,3,5,5,6,6-D8 DIHYDROCHLORIDE | | Synonyms: | Piperazine-2,2,3,3,5,5,6,6-d8 2hc1;Piperazine-2,2,3,3,5,5,6,6-D8HCl;PIPERAZINE-2,2,3,3,5,5,6,6-D8 2HCL;PIPERAZINE-2,2,3,3,5,5,6,6-D8 DIHYDROCHLORIDE;Piperazine--d8 2HCl;2,2,3,3,5,5,6,6-octadeuteriopiperazine;Piperazine-2,2,3,3,5,5,6,6-d8,dihydrochloride, monohydrate (9CI);Piperazine-2,2,3,3,5,5,6,6-d8 dihydrochloride hydrate | | CAS: | 314062-45-8 | | MF: | C4H13ClN2O | | MW: | 140.61 | | EINECS: | | | Product Categories: | Alphabetical Listings;P;Stable Isotopes | | Mol File: | 314062-45-8.mol |  |
| | PIPERAZINE-2,2,3,3,5,5,6,6-D8 DIHYDROCHLORIDE Chemical Properties |
| Melting point | >300 °C(lit.) | | InChI | InChI=1S/C4H10N2.ClH.H2O/c1-2-6-4-3-5-1;;/h5-6H,1-4H2;1H;1H2 | | InChIKey | VKBJNABNNJYRTK-UHFFFAOYSA-N | | SMILES | C1([H])([H])NC([H])([H])C([H])([H])NC1([H])[H].Cl.O |
| | PIPERAZINE-2,2,3,3,5,5,6,6-D8 DIHYDROCHLORIDE Usage And Synthesis |
| | PIPERAZINE-2,2,3,3,5,5,6,6-D8 DIHYDROCHLORIDE Preparation Products And Raw materials |
|