| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2,4-Dichloroquinoline Basic information |
| Product Name: | 2,4-Dichloroquinoline | | Synonyms: | AURORA KA-3862;IFLAB-BB F1706-0118;2,4-Dichloroquinoline 98%;2,4-dichloroquinoline(SALTDATA: FREE);2-4-Dichloro-1-azanaphthalene;Quinoline,2,4-dichloro-;2,4-Dichloroquinoline>;2,4-Dichloroquinoline | | CAS: | 703-61-7 | | MF: | C9H5Cl2N | | MW: | 198.05 | | EINECS: | 640-568-2 | | Product Categories: | pharmacetical | | Mol File: | 703-61-7.mol |  |
| | 2,4-Dichloroquinoline Chemical Properties |
| Melting point | 52-54 | | Boiling point | 282°C(lit.) | | density | 1.4178 (rough estimate) | | refractive index | 1.6610 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol | | form | Solid | | pka | -1.10±0.50(Predicted) | | color | White | | λmax | 305nm(MeOH)(lit.) | | InChI | InChI=1S/C9H5Cl2N/c10-7-5-9(11)12-8-4-2-1-3-6(7)8/h1-5H | | InChIKey | QNBJYUUUYZVIJP-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=CC=2)C(Cl)=CC=1Cl | | CAS DataBase Reference | 703-61-7(CAS DataBase Reference) |
| | 2,4-Dichloroquinoline Usage And Synthesis |
| Uses | 2,4-Dichloroquinoline is used in the synthesis of tRNA synthetase inhibitors with antibacterial activity against gram-positive bacteria. Also used in the preparation of arylquinolines displaying anthelmintic properties. | | Synthesis | The synthesis of 2,4-dichloroquinoline is as follows:A suspension of quinoline-2,4-diol (150 g, 931 mmol) in POCl3 (975 mL, 10.4 mol) was stirred at reflux for 6 hr and the reaction mixture was concentrated. The residue was diluted with CHCl3 (500 mL) and the solution was poured into ice water. The aqueous layer was extracted with CHCl3 (three times). The combined organic layer was dried over MgSO4, filtrated, concentrated, and purified by flash chromatography (silica gel, 20% EtOAc in hexane) to give 2,4-dichloroquinoline (177 g, 96%) as a pale brown solid.
 |
| | 2,4-Dichloroquinoline Preparation Products And Raw materials |
|