- Dehydrocavidine
-
- $207.00
-
2026-07-27
- CAS:83218-34-2
- Purity:
- Supply Ability: 10g
- Dehydrocavidine
-
- $9.80
-
2020-01-10
- CAS:83218-34-2
- Min. Order: 1KG
- Purity: ≥98%
- Supply Ability: 20 tons
|
| | Dehydrocavidine Basic information |
| Product Name: | Dehydrocavidine | | Synonyms: | Hexadehydrocavidine;Hexadehydrothalictrifoline;YHL I;AC1L4JQK;dehyrocaridine;Benzo[a]-1,3-benzodioxolo[4,5-g]quinolizin-13-ium,8,9-dimethoxy-6-methyl-;https://www.chemicalbook.com/ProdSupplierGNCB4760438.htm;Dehydrocavidine | | CAS: | 83218-34-2 | | MF: | C21H18NO4+ | | MW: | 348.38 | | EINECS: | | | Product Categories: | | | Mol File: | 83218-34-2.mol |  |
| | Dehydrocavidine Chemical Properties |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Powder | | InChI | InChI=1S/C21H18NO4/c1-12-14-4-5-17-21(26-11-25-17)16(14)10-22-7-6-13-8-18(23-2)19(24-3)9-15(13)20(12)22/h4-10H,11H2,1-3H3/q+1 | | InChIKey | TWSZDJCOYVYRGM-UHFFFAOYSA-N | | SMILES | CC1C2C=CC3OCOC=3C=2C=[N+]2C=CC3C=C(OC)C(OC)=CC=3C=12 |
| | Dehydrocavidine Usage And Synthesis |
| Chemical Properties | Light yellow needle-shaped crystals, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Coptis chinensis. | | Uses | Dehydrocavidine is an alkaloid found in Corydalis saxicola, and displays potential anti-hepatitis B activity. | | target | Bcl-2/Bax | Caspase | IL Receptor | PARP | cAMP | PGE |
| | Dehydrocavidine Preparation Products And Raw materials |
|