| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
marketing1@energy-chemical.com |
2-((3,5-Di-tert-butyl-4-hydroxyphenyl)-methylene)-4-cyclopentene-1,3-dione manufacturers
- TX-1123
-
- $1520.00
-
2026-07-27
- CAS:157397-06-3
- Purity:
- Supply Ability: 10g
|
| | 2-((3,5-Di-tert-butyl-4-hydroxyphenyl)-methylene)-4-cyclopentene-1,3-dione Basic information |
| | 2-((3,5-Di-tert-butyl-4-hydroxyphenyl)-methylene)-4-cyclopentene-1,3-dione Chemical Properties |
| Boiling point | 442.4±44.0 °C(Predicted) | | density | 1.137±0.06 g/cm3(Predicted) | | storage temp. | +2C to +8C | | solubility | Soluble in DMSO (10mg/ml) | | form | Yellow solid | | pka | 10.04±0.50(Predicted) | | color | yellow | | InChI | 1S/C20H24O3/c1-19(2,3)14-10-12(9-13-16(21)7-8-17(13)22)11-15(18(14)23)20(4,5)6/h7-11,23H,1-6H3 | | InChIKey | VUEUMQIBGLKJJD-UHFFFAOYSA-N | | SMILES | Oc1c(cc(cc1C(C)(C)C)C=C2C(=O)C=CC2=O)C(C)(C)C |
| WGK Germany | WGK 1 | | Storage Class | 11 - Combustible Solids |
| | 2-((3,5-Di-tert-butyl-4-hydroxyphenyl)-methylene)-4-cyclopentene-1,3-dione Usage And Synthesis |
| Uses | TX-1123 is a protein tyrosine kinase inhibitor, having low mitochondrial toxicity and antitumor activity. | | Biological Activity | Cell permeable: yes', 'Primary Target
Src', 'Product competes with ATP.', 'Reversible: yes', 'Target IC50: 2.2, 3.2, and 9.6 μM against Src, eEF2-K, and PKA, respectively | | IC 50 | COX-2: 1.16 nM (IC50); COX-1: 15.7 μM (IC50) | | storage | +4°C |
| | 2-((3,5-Di-tert-butyl-4-hydroxyphenyl)-methylene)-4-cyclopentene-1,3-dione Preparation Products And Raw materials |
|