TN-16 manufacturers
- TN-16
-
- $1.00
-
2026-10-10
- CAS:33016-12-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20T
- TN-16
-
- $31.00
-
2026-07-14
- CAS:33016-12-5
- Purity: 99.68%
- Supply Ability: 10g
|
| Product Name: | TN-16 | | Synonyms: | TN-16;2,4-Pyrrolidinedione, 3-(1-(phenylamino)ethylidene)-5-(phenylmethyl)- (9ci);2,4-Pyrrolidinedione, 3-(1-anilinoethylidene)-5-benzyl- (8ci);Nsc 239274;3-[1-(Phenylamino)ethylidene]-5-(phenylmethyl)-2,4-pyrrolidinedione;3-(ANILINOETHYLIDENE)-5-BENZYLPYRROLIDINE-2,4-DIONE;3-(1-ANILINOETHYLIDENE)-5-BENZYLPYRROLIDINE-2,4-DIONE;2,4-Pyrrolidinedione, 3-[1-(phenylamino)ethylidene]-5-(phenylmethyl)- | | CAS: | 33016-12-5 | | MF: | C19H18N2O2 | | MW: | 306.36 | | EINECS: | | | Product Categories: | | | Mol File: | 33016-12-5.mol |  |
| | TN-16 Chemical Properties |
| Melting point | 182~185℃ | | Boiling point | 532.7±50.0 °C(Predicted) | | density | 1.249±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: ≥17mg/mL | | form | powder | | pka | 10.53±0.40(Predicted) | | color | white to tan | | InChI | 1S/C19H18N2O2/c1-13(20-15-10-6-3-7-11-15)17-18(22)16(21-19(17)23)12-14-8-4-2-5-9-14/h2-11,16,20H,12H2,1H3,(H,21,23)/b17-13- | | InChIKey | KWSXUGYAGMSUTN-LGMDPLHJSA-N | | SMILES | C\C(Nc1ccccc1)=C2\C(=O)NC(Cc3ccccc3)C2=O |
| Hazard Codes | Xi,N | | Risk Statements | 43-50/53 | | Safety Statements | 36/37-60-61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Skin Sens. 1 |
| | TN-16 Usage And Synthesis |
| Uses | TN-16 is an antitumor drug that blocks microtubule assembly. Tubulin inhibitor. | | Biological Activity | 3-(l-anilinoethylidene)-5-benzylpyrrolidine-2,4-dione (TN-16), a tenuazonic acid derivative, is a synthetic antitumor agent which arrests mitosis of tumor cells at metaphase. It is a colchicine site binding agent and a powerful autophagy flux inhibitor th at could be used as a conventional autophagy inhibitor with anti-cancer potential in pre-clinical trials.', 'Inhibitor of microtubule assembly', 'TN-16 is a synthetic compound th at blocks the assembly, and promotes the dissociation of microtubules. It can prevent the b-TrCP-mediated degradation of the transcription factor Gli2, leading to the up-regulation of BMP-2 and supporting a role for microtubule formation in the regulation of bone formation. |
| | TN-16 Preparation Products And Raw materials |
|