|
|
| | 1,4-Bis(hydroxydimethylsilyl)benzene Basic information | | Preparation |
| | 1,4-Bis(hydroxydimethylsilyl)benzene Chemical Properties |
| Melting point | 133-136 °C(lit.) | | Boiling point | 289.6±36.0 °C(Predicted) | | density | 1.02±0.1 g/cm3(Predicted) | | Fp | >110°C | | storage temp. | 2-8°C | | pka | 13.91±0.53(Predicted) | | Appearance | White to off-white Solid | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/C10H18O2Si2/c1-13(2,11)9-5-7-10(8-6-9)14(3,4)12/h5-8,11-12H,1-4H3 | | InChIKey | YBNBOGKRCOCJHH-UHFFFAOYSA-N | | SMILES | C1([Si](C)(C)O)=CC=C([Si](C)(C)O)C=C1 | | CAS DataBase Reference | 2754-32-7(CAS DataBase Reference) | | EPA Substance Registry System | Silanol, 1,4-phenylenebis[dimethyl- (2754-32-7) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 2931900090 |
| | 1,4-Bis(hydroxydimethylsilyl)benzene Usage And Synthesis |
| Preparation | Using p-dibromobenzene, dimethyldimethoxysilane, and magnesium shavings as raw materials, the phenylenesiloxysilane monomer 1,4-bis(dimethylmethoxysilyl)benzene was synthesized via the Grignard method. The target product, 1,4-Bis(hydroxydimethylsilyl)benzene, was then obtained via hydrolysis. | | Uses | 1,4-Bis(hydroxydimethylsilyl)benzene is an effective silicon nucleophile for catalyzed palladium cross-coupling reactions. |
| | 1,4-Bis(hydroxydimethylsilyl)benzene Preparation Products And Raw materials |
|