2,6-DIPHENYL-4-(2,4,6-TRIPHENYL-1-PYRIDINIO)PHENOLATE manufacturers
|
| | 2,6-DIPHENYL-4-(2,4,6-TRIPHENYL-1-PYRIDINIO)PHENOLATE Basic information |
| Product Name: | 2,6-DIPHENYL-4-(2,4,6-TRIPHENYL-1-PYRIDINIO)PHENOLATE | | Synonyms: | 2,6-DIPHENYL-4-(2,4,6-TRIPHENYL-1-PYRIDINIO)PHENOLATE;2,6-DIPHENYL-4-(2,4,6-TRIPHENYLPYRIDINIO)PHENOLATE;2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate, 2,6-Diphenyl-4-(2,4,6-triphenylpyridinio)phenolate;1-(4-Oxylato-3,5-diphenylphenyl)-2,4,6-triphenylpyridinium;2,4,6-Triphenyl-1-(2'-oxylato-1,1':3',1''-terbenzene-5'-yl)pyridinium;2,6-Diphenyl-4-(2,4,6-triphenylpyridinio)benzene-1-olate;4-(2,4,6-Triphenylpyridinio)-2,6-diphenylphenolate;2,6-Diphenyl-4-(2,4,6-triphenyl-1-pyridinio)phenolate,Reichardt’s dye | | CAS: | 10081-39-7 | | MF: | C41H29NO | | MW: | 551.69 | | EINECS: | | | Product Categories: | Heterocyclic Compounds | | Mol File: | 10081-39-7.mol |  |
| | 2,6-DIPHENYL-4-(2,4,6-TRIPHENYL-1-PYRIDINIO)PHENOLATE Chemical Properties |
| Melting point | 271-275 °C(lit.) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Sonicated) | | form | Solid | | color | Dark Green to Very Dark Grey | | λmax | 306 nm 551 nm (2nd) | | BRN | 1444580 | | Stability: | Stable. Incompatible with acids and strong oxidizing agents. | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C41H29NO/c43-41-37(31-18-8-2-9-19-31)28-36(29-38(41)32-20-10-3-11-21-32)42-39(33-22-12-4-13-23-33)26-35(30-16-6-1-7-17-30)27-40(42)34-24-14-5-15-25-34/h1-29H | | InChIKey | UWOVWIIOKHRNKU-UHFFFAOYSA-N | | SMILES | [O-]c1c(cc(cc1-c2ccccc2)-[n+]3c(cc(cc3-c4ccccc4)-c5ccccc5)-c6ccccc6)-c7ccccc7 |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2,6-DIPHENYL-4-(2,4,6-TRIPHENYL-1-PYRIDINIO)PHENOLATE Usage And Synthesis |
| Chemical Properties | black-violet glittering crystals | | Uses | Reichardt's dye, a solvatochromic betaine dye has been used for the determination of solvent polarity.
|
| | 2,6-DIPHENYL-4-(2,4,6-TRIPHENYL-1-PYRIDINIO)PHENOLATE Preparation Products And Raw materials |
|