| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:2,2',4,4',5,6'-HexabroMo diphenyl ether;BDE No 154 solution
CAS:207122-15-4
Purity:99% Package:10Mg,100Mg,1g
|
| Company Name: |
ShangHai Anpel Co, Ltd.
|
| Tel: |
18502138905 |
| Email: |
shanpel@anpel.com.cn |
| Products Intro: |
Product Name:2，2‘，4，4‘，5，6‘-Hexabromodiphenyl Ether
CAS:207122-15-4
Purity:50ppm Package:50mg/L于异辛烷，1ml Remarks:CDAA-350154-1mg
|
|
| | 2,2',4,4',5,6'-HEXABROMODIPHENYL ETHER Basic information |
| Product Name: | 2,2',4,4',5,6'-HEXABROMODIPHENYL ETHER | | Synonyms: | 2,2',4,4',5,6'-HEXABROMODIPHENYL ETHER;BDE-154;BDE No 154 solution;PBDE 154, 2,2μ,4,4μ,5,6μ-Hexabromodiphenyl ether solution;2,2',4,4',5,6'-Hexabromodiphenyl ether,50 μL/mL in Isooctane;Benzene, 1,3,5-tribromo-2-(2,4,5-tribromophenoxy)-;1,3,5-Tribromo-2-(2,4,5-tribromophenoxy)benzene;1,2,4-tribromo-5-(2,4,6-tribromophenoxy)benzene | | CAS: | 207122-15-4 | | MF: | C12H4Br6O | | MW: | 643.58 | | EINECS: | 208-759-1 | | Product Categories: | | | Mol File: | 207122-15-4.mol |  |
| | 2,2',4,4',5,6'-HEXABROMODIPHENYL ETHER Chemical Properties |
| Melting point | 137.5-138.5 °C(Solv: tetrahydrofuran (109-99-9); acetonitrile (75-05-8)) | | Boiling point | 471 °C | | density | 2.502±0.06 g/cm3(Predicted) | | Fp | -12 °C | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly, Heated), Ethyl Acetate (Slightly) | | form | Solid | | color | Off-White to Light Yellow | | Major Application | environmental | | InChI | 1S/C12H4Br6O/c13-5-1-9(17)12(10(18)2-5)19-11-4-7(15)6(14)3-8(11)16/h1-4H | | InChIKey | VHNPZYZQKWIWOD-UHFFFAOYSA-N | | SMILES | Brc1cc(Br)c(Oc2cc(Br)c(Br)cc2Br)c(Br)c1 | | EPA Substance Registry System | Benzene, 1,3,5-tribromo-2-(2,4,5-tribromophenoxy)- (207122-15-4) |
| Hazard Codes | F,Xn,N | | Risk Statements | 11-38-50/53-65-67 | | Safety Statements | 60-61-62-33-29-16-9 | | RIDADR | UN 1262 3/PG 2 | | WGK Germany | 2 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1
Asp. Tox. 1
Flam. Liq. 2
Skin Irrit. 2
STOT SE 3 |
| | 2,2',4,4',5,6'-HEXABROMODIPHENYL ETHER Usage And Synthesis |
| Uses | 2,2',4,4',5,6'-Hexabromodiphenyl ether is a hepatotoxic polybrominated diphenyl ester (PBDE) that is commonly used as a flame retardant. 2,2',4,4',5,6'-Hexabromodiphenyl ether is also sometimes found in food and meats as well, posing a significant risk to humans (especially during pregnancy) and/or animals that consume it. One of the new POPs under the Stockholm Convention | | Definition | ChEBI: 2,2',4,4',5,6'-Hexabromodiphenyl ether is an aromatic ether and an organobromine compound. |
| | 2,2',4,4',5,6'-HEXABROMODIPHENYL ETHER Preparation Products And Raw materials |
|