|
|
| | 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride Basic information |
| | 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride Chemical Properties |
| storage temp. | 2-8°C | | Major Application | pharmaceutical | | InChI | 1S/C11H8Cl2N2O.ClH/c12-8-1-2-9(10(13)5-8)11(16)6-15-4-3-14-7-15;/h1-5,7H,6H2;1H | | InChIKey | XCZWBNAWVGVDAL-UHFFFAOYSA-N | | SMILES | Clc1c(ccc(c1)Cl)C(=O)C[n]2cncc2.Cl |
| WGK Germany | WGK 3 | | HS Code | 2933290000 | | Storage Class | 13 - Non Combustible Solids |
| | 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride Usage And Synthesis |
| Uses | These Secondary Standards are qualified as Certified Reference Materials. These are suitable for use in several analytical applications including but not limited to pharma release testing, pharma method development for qualitative and quantitative analyses, food and beverage quality control testing, and other calibration requirements. |
| | 1-(2,4-Dichloro-phenyl)-2-imidazol-1-yl-ethanone hydrochloride Preparation Products And Raw materials |
|