1-(2,4-Dichlorophenyl)-2-(1H-imidazole-1-yl) ethanone manufacturers
|
| | 1-(2,4-Dichlorophenyl)-2-(1H-imidazole-1-yl) ethanone Basic information |
| Product Name: | 1-(2,4-Dichlorophenyl)-2-(1H-imidazole-1-yl) ethanone | | Synonyms: | AURORA KA-666;1-(2,4-DICHLOROPHENYL)-2-(1H-IMIDAZOL-1-YL)ETHANONE;1-(2,4-DICHLOROPHENYL)-2-IMIDAZOL-1-YL-ETHANONE;2',4'-DICHLORO-2-IMIDAZOLYLACETOPHENONE;2,4'-Dichloro Phenyl-2-Imidazole-1-Ethanone;2',4'-Dichloro-2-(1H-imidazol-1-yl)acetophenone;1-(2,4-dichlorophenyl)-2-(1H-imidazol-1-yl)ethan-1-one;1-(2,4-Dichlorophenacyl)-1H-imidazole | | CAS: | 46503-52-0 | | MF: | C11H8Cl2N2O | | MW: | 255.1 | | EINECS: | 256-273-3 | | Product Categories: | | | Mol File: | 46503-52-0.mol |  |
| | 1-(2,4-Dichlorophenyl)-2-(1H-imidazole-1-yl) ethanone Chemical Properties |
| Melting point | 76-78 °C(Solv: ethyl ether (60-29-7)) | | Boiling point | 441.1±35.0 °C(Predicted) | | density | 1.38±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | pka | 5.97±0.10(Predicted) | | color | Orange | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C11H8Cl2N2O/c12-8-1-2-9(10(13)5-8)11(16)6-15-4-3-14-7-15/h1-5,7H,6H2 | | InChIKey | YAEYBUZMILPYLT-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(Cl)C=C1Cl)CN1C=NC=C1 | | CAS DataBase Reference | 46503-52-0(CAS DataBase Reference) |
| WGK Germany | WGK 3 | | HS Code | 2933299090 | | Storage Class | 11 - Combustible Solids |
| | 1-(2,4-Dichlorophenyl)-2-(1H-imidazole-1-yl) ethanone Usage And Synthesis |
| Uses | These Reference Materials are suitable for use in several analytical applications including, but not limited to, method development for qualitative and quantitative analyses, daily calibration, and routine quality control testing. |
| | 1-(2,4-Dichlorophenyl)-2-(1H-imidazole-1-yl) ethanone Preparation Products And Raw materials |
|