|
|
| | N,N'-Dimorpholinomethane Basic information |
| Product Name: | N,N'-Dimorpholinomethane | | Synonyms: | N,N’-Methylenebismorpholine;DIMORPHOLINOMETHANE;DIMORPHOLINOMETHONE;Morpholine,4,4-Methylenebis-;Methylene-bis-morpholine,N,N'-;MORPHOLINE44METHYLENEDI;44METHYLENEBISMORPHOLINE;BIS-(MORPHOLINE-)METHANE | | CAS: | 5625-90-1 | | MF: | C9H18N2O2 | | MW: | 186.25 | | EINECS: | 227-062-3 | | Product Categories: | | | Mol File: | 5625-90-1.mol |  |
| | N,N'-Dimorpholinomethane Chemical Properties |
| Boiling point | 122-124°C 12mm | | density | 1,04 g/cm3 | | refractive index | 1.4790 (estimate) | | storage temp. | 2-8°C | | pka | 6.91±0.10(Predicted) | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Soluble in water. | | InChI | InChI=1S/C9H18N2O2/c1-5-12-6-2-10(1)9-11-3-7-13-8-4-11/h1-9H2 | | InChIKey | MIFZZKZNMWTHJK-UHFFFAOYSA-N | | SMILES | C(N1CCOCC1)N1CCOCC1 | | CAS DataBase Reference | 5625-90-1(CAS DataBase Reference) | | EPA Substance Registry System | Morpholine, 4,4'-methylenebis- (5625-90-1) |
| | N,N'-Dimorpholinomethane Usage And Synthesis |
| Uses | It is employed as intermediate for pharmaceutical. | | Synthesis | In a 500 mL four-necked flask equipped with an electric stirrer and a condenser tube, the solvent chlorobenzene, 174 g (2 mol) morpholine and 0.348 g 5% aqueous dodecyldimethylbenzylammonium hydroxide were added sequentially, and 81.08 g (1 mol) of 37% formaldehyde solution was slowly put into the four-necked flask under an ice-water bath, and the temperature was not exceeded at 70 ?? during the feeding process, and the temperature was kept at 70 ?? for 3 hrs after finishing feeding. It was held for 3 hours, then cooled to room temperature and distilled under reduced pressure to remove the solvent chlorobenzene and water to obtain the target product N,N'-methylenebismorpholine 189.23 g in 98.01% yield. |
| | N,N'-Dimorpholinomethane Preparation Products And Raw materials |
| Raw materials | Morpholine, 4-[[(trimethylsilyl)oxy]methyl]--->[1,1'-Binaphthalene]-2,2'-diol, 5,5',6,6',7,7',8,8'-octahydro-3,3'-bis(4-morpholinylmethyl)-, (1S)--->1,3,3-tris(benzenesulfonyl)propylsulfonylbenzene-->4-Morpholinamine, N-methylene--->4-methylenemorpholin-4-ium chloride-->trimorpholylmethane-->BIS(PHENYLSULFONYL)METHANE-->1,1-BIS(PHENYLSULFONYL)ETHYLENE-->4-(Trimethylsilyl)morpholine-->Dichloromethane-->N,N,N',N'-TETRAMETHYLDIAMINOMETHANE-->Formaldehyde | | Preparation Products | Morpholine, 4-(methoxymethyl)--->4-Morpholinemethanol-->4-Formylmorpholine |
|