|
|
| | isobutyl 2-(methylamino)benzoate Basic information |
| Product Name: | isobutyl 2-(methylamino)benzoate | | Synonyms: | N-Methylanthranilic acid isobutyl ester;isobutyl 2-(methylamino)benzoate;Benzoic acid, 2-(methylamino)-, 2-methylpropyl ester;Isobutyl-2-(methylamino)benzoat;2-(methylamino)-benzoic acid 2-methylpropyl ester;Isobutyl 2-(methylamino);Isobutyl N-methylanthranilate;ISOBUTYLN-METHYLANTHRANILATE | | CAS: | 65505-24-0 | | MF: | C12H17NO2 | | MW: | 207.27 | | EINECS: | 265-798-7 | | Product Categories: | | | Mol File: | 65505-24-0.mol |  |
| | isobutyl 2-(methylamino)benzoate Chemical Properties |
| Boiling point | 296.9±13.0 °C(Predicted) | | density | 1.053±0.06 g/cm3(Predicted) | | FEMA | 4149 | ISOBUTYL N-METHYLANTHRANILATE | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 2.83±0.10(Predicted) | | Odor | at 100.00 %. fruity grapefruit grape | | Odor Type | fruity | | JECFA Number | 1548 | | Major Application | flavors and fragrances | | Cosmetics Ingredients Functions | PERFUMING | | InChI | 1S/C12H17NO2/c1-9(2)8-15-12(14)10-6-4-5-7-11(10)13-3/h4-7,9,13H,8H2,1-3H3 | | InChIKey | WKYZGTHZBSYUFI-UHFFFAOYSA-N | | SMILES | N(C)c1c(cccc1)C(=O)OCC(C)C | | LogP | 4.10 | | EPA Substance Registry System | Benzoic acid, 2-(methylamino)-, 2-methylpropyl ester (65505-24-0) |
| WGK Germany | WGK 2 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | isobutyl 2-(methylamino)benzoate Usage And Synthesis |
| Description | Although reported in the 1970 and 1975 NAS food additive surveys, no technical effect was reported. | | Chemical Properties | Pale straw-colored or almost colorless liquid. Very slightly soluble in water, soluble in alcohol and oils. Sweet and floral-fruity odor of PetitgrainGrapefruit type. Good tenacity and very attractive overall fragrance. Sweet, fruity Grape- and Grapefruit-like taste in concentrations Mow 20 ppm. | | Synthesis | Isobutyl 2-(methylamino)benzoateis prepared from iso-Butyianthranilate by Methylation or, more recently: from ,i-Methylisatoic anhydride plus iso-Butylalcohol by conventional esterification method. |
| | isobutyl 2-(methylamino)benzoate Preparation Products And Raw materials |
|