| Company Name: |
Alfa Chemistry |
| Tel: |
1-516-6625404 |
| Email: |
support@alfa-chemistry.com |
[S-(R*,S*)]-5-(1,5-dimethylhexen-4-yl)-2-methyl-1,3-cyclohexa-1,3-diene manufacturers
- Zingiberene (7CI)
-
- $30.00
-
2026-08-07
- CAS:495-60-3
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 6000KG
|
| | [S-(R*,S*)]-5-(1,5-dimethylhexen-4-yl)-2-methyl-1,3-cyclohexa-1,3-diene Basic information |
| Product Name: | [S-(R*,S*)]-5-(1,5-dimethylhexen-4-yl)-2-methyl-1,3-cyclohexa-1,3-diene | | Synonyms: | [S-(R*,S*)]-5-(1,5-dimethylhexen-4-yl)-2-methyl-1,3-cyclohexa-1,3-diene;α-zingiberene,[S-(R,S)]-5-(1,5-dimethyl-4-hexenyl)-2-methyl-1,3-cyclohexadiene,(-)-zingiberene;1,3-Cyclohexadiene, 5-(1,5-dimethyl-4-hexenyl)-2-methyl-, (S-(R*,S*))-;(R)-5-[(S)-1,5-Dimethyl-4-hexenyl]-2-methyl-1,3-cyclohexadiene;(R)-2-Methyl-5-((S)-6-methylhept-5-en-2-yl)-cyclohexa-1,3-diene;(5R)-2-methyl-5-[(2S)-6-methylhept-5-en-2-yl]cyclohexa-1,3-diene;(5R)-5-[(1S)-1,5-dimethylhex-4-enyl]-2-methyl-cyclohexa-1,3-diene;Zingiberene (7CI) | | CAS: | 495-60-3 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | 2078042 | | Product Categories: | | | Mol File: | 495-60-3.mol | ![[S-(R*,S*)]-5-(1,5-dimethylhexen-4-yl)-2-methyl-1,3-cyclohexa-1,3-diene Structure](CAS/GIF/495-60-3.gif) |
| | [S-(R*,S*)]-5-(1,5-dimethylhexen-4-yl)-2-methyl-1,3-cyclohexa-1,3-diene Chemical Properties |
| Boiling point | 128-129 °C(Press: 9 Torr) | | density | 0.8713 g/cm3 | | storage temp. | Amber Vial, -86°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Hexane (Slightly), Methanol (Slightly) | | form | Oil | | color | Colourless | | Odor | at 10.00 % in dipropylene glycol. spice fresh sharp | | Odor Type | spicy | | Stability: | Light Sensitive, Temperature Sensitive | | InChI | InChI=1/C15H24/c1-12(2)6-5-7-14(4)15-10-8-13(3)9-11-15/h6,8-10,14-15H,5,7,11H2,1-4H3/t14-,15+/s3 | | InChIKey | KKOXKGNSUHTUBV-HRCJQKRTNA-N | | SMILES | C1C[C@@H]([C@H](C)CC/C=C(\C)/C)C=CC=1C |&1:2,3,r| | | LogP | 6.375 (est) |
| | [S-(R*,S*)]-5-(1,5-dimethylhexen-4-yl)-2-methyl-1,3-cyclohexa-1,3-diene Usage And Synthesis |
| Uses | α-Zingiberene is a sesquiterpine found in leaf glandular trichomes that is currently being evaluated for its cytotoxicity towards human tumour cell lines. | | Definition | ChEBI: 2-Methylcyclohexa-1,3-diene in which a hydrogen at the 5 position is substituted (R configuration) by a 6-methyl-hept-5-en-2-yl group (S configuration). It is a sesquiterpene found in the dried rhizomes of Indonesian ginge
, Zingiber officinale. |
| | [S-(R*,S*)]-5-(1,5-dimethylhexen-4-yl)-2-methyl-1,3-cyclohexa-1,3-diene Preparation Products And Raw materials |
|